Warning: Permanently added '13.121.92.252' (ED25519) to the list of known hosts. You can reproduce this build on your computer by running: sudo dnf install copr-rpmbuild /usr/bin/copr-rpmbuild --verbose --drop-resultdir --task-url https://copr.fedorainfracloud.org/backend/get-build-task/8412293-fedora-rawhide-s390x --chroot fedora-rawhide-s390x Version: 1.2 PID: 18417 Logging PID: 18418 Task: {'allow_user_ssh': False, 'appstream': False, 'background': True, 'build_id': 8412293, 'buildroot_pkgs': [], 'chroot': 'fedora-rawhide-s390x', 'enable_net': False, 'fedora_review': False, 'git_hash': 'a4137089455ffbcee6443b51ff92cfcd61970c9b', 'git_repo': 'https://copr-dist-git.fedorainfracloud.org/git/dmalcolm/gcc-15-smoketest-3/cinnamon-session', 'isolation': 'default', 'memory_reqs': 2048, 'package_name': 'cinnamon-session', 'package_version': '6.4.0-1', 'project_dirname': 'gcc-15-smoketest-3', 'project_name': 'gcc-15-smoketest-3', 'project_owner': 'dmalcolm', 'repo_priority': None, 'repos': [{'baseurl': 'https://download.copr.fedorainfracloud.org/results/dmalcolm/gcc-15-smoketest-3/fedora-rawhide-s390x/', 'id': 'copr_base', 'name': 'Copr repository', 'priority': None}, {'baseurl': 'https://fedorapeople.org/~dmalcolm/gcc/gcc-15-mass-prebuild/$basearch', 'id': 'https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch', 'name': 'Additional repo https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch'}], 'sandbox': 'dmalcolm/gcc-15-smoketest-3--dmalcolm', 'source_json': {}, 'source_type': None, 'ssh_public_keys': None, 'storage': 0, 'submitter': 'dmalcolm', 'tags': [], 'task_id': '8412293-fedora-rawhide-s390x', 'timeout': 115200, 'uses_devel_repo': False, 'with_opts': [], 'without_opts': []} Running: git clone https://copr-dist-git.fedorainfracloud.org/git/dmalcolm/gcc-15-smoketest-3/cinnamon-session /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session --depth 500 --no-single-branch --recursive cmd: ['git', 'clone', 'https://copr-dist-git.fedorainfracloud.org/git/dmalcolm/gcc-15-smoketest-3/cinnamon-session', '/var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session', '--depth', '500', '--no-single-branch', '--recursive'] cwd: . rc: 0 stdout: stderr: Cloning into '/var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session'... Running: git checkout a4137089455ffbcee6443b51ff92cfcd61970c9b -- cmd: ['git', 'checkout', 'a4137089455ffbcee6443b51ff92cfcd61970c9b', '--'] cwd: /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session rc: 0 stdout: stderr: Note: switching to 'a4137089455ffbcee6443b51ff92cfcd61970c9b'. You are in 'detached HEAD' state. You can look around, make experimental changes and commit them, and you can discard any commits you make in this state without impacting any branches by switching back to a branch. If you want to create a new branch to retain commits you create, you may do so (now or later) by using -c with the switch command. Example: git switch -c Or undo this operation with: git switch - Turn off this advice by setting config variable advice.detachedHead to false HEAD is now at a413708 automatic import of cinnamon-session Running: dist-git-client sources cmd: ['dist-git-client', 'sources'] cwd: /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session rc: 0 stdout: stderr: INFO: Reading stdout from command: git rev-parse --abbrev-ref HEAD INFO: Reading stdout from command: git rev-parse HEAD INFO: Reading sources specification file: sources INFO: Downloading cinnamon-session-6.4.0.tar.gz INFO: Reading stdout from command: curl --help all INFO: Calling: curl -H Pragma: -o cinnamon-session-6.4.0.tar.gz --location --connect-timeout 60 --retry 3 --retry-delay 10 --remote-time --show-error --fail --retry-all-errors https://copr-dist-git.fedorainfracloud.org/repo/pkgs/dmalcolm/gcc-15-smoketest-3/cinnamon-session/cinnamon-session-6.4.0.tar.gz/md5/ca6cd78c4531262274986f0232353c26/cinnamon-session-6.4.0.tar.gz % Total % Received % Xferd Average Speed Time Time Time Current Dload Upload Total Spent Left Speed 100 162k 100 162k 0 0 251k 0 --:--:-- --:--:-- --:--:-- 251k INFO: Reading stdout from command: md5sum cinnamon-session-6.4.0.tar.gz /usr/bin/tail: /var/lib/copr-rpmbuild/main.log: file truncated Running (timeout=115200): unbuffer mock --spec /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session/cinnamon-session.spec --sources /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session --resultdir /var/lib/copr-rpmbuild/results --uniqueext 1734762221.542729 -r /var/lib/copr-rpmbuild/results/configs/child.cfg INFO: mock.py version 6.0 starting (python version = 3.13.0, NVR = mock-6.0-1.fc41), args: /usr/libexec/mock/mock --spec /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session/cinnamon-session.spec --sources /var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session --resultdir /var/lib/copr-rpmbuild/results --uniqueext 1734762221.542729 -r /var/lib/copr-rpmbuild/results/configs/child.cfg Start(bootstrap): init plugins INFO: tmpfs initialized INFO: selinux enabled INFO: chroot_scan: initialized INFO: compress_logs: initialized Finish(bootstrap): init plugins Start: init plugins INFO: tmpfs initialized INFO: selinux enabled INFO: chroot_scan: initialized INFO: compress_logs: initialized Finish: init plugins INFO: Signal handler active Start: run INFO: Start(/var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session/cinnamon-session.spec) Config(fedora-rawhide-s390x) Start: clean chroot Finish: clean chroot Mock Version: 6.0 INFO: Mock Version: 6.0 Start(bootstrap): chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-rawhide-s390x-bootstrap-1734762221.542729/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start(bootstrap): cleaning package manager metadata Finish(bootstrap): cleaning package manager metadata INFO: Guessed host environment type: unknown INFO: Using container image: registry.fedoraproject.org/fedora:rawhide INFO: Pulling image: registry.fedoraproject.org/fedora:rawhide INFO: Tagging container image as mock-bootstrap-3a3edbbf-72a5-4366-a5ce-62742ab317d0 INFO: Checking that f10fff61553e02a5aa7b29e9e105d0a320399ace5d6136a61b40fa90120aec24 image matches host's architecture INFO: Copy content of container f10fff61553e02a5aa7b29e9e105d0a320399ace5d6136a61b40fa90120aec24 to /var/lib/mock/fedora-rawhide-s390x-bootstrap-1734762221.542729/root INFO: mounting f10fff61553e02a5aa7b29e9e105d0a320399ace5d6136a61b40fa90120aec24 with podman image mount INFO: image f10fff61553e02a5aa7b29e9e105d0a320399ace5d6136a61b40fa90120aec24 as /var/lib/containers/storage/overlay/b6e2a1f6758b7750ef0cf8ea789ec838e60891367b0096baf9a63392503ae567/merged INFO: umounting image f10fff61553e02a5aa7b29e9e105d0a320399ace5d6136a61b40fa90120aec24 (/var/lib/containers/storage/overlay/b6e2a1f6758b7750ef0cf8ea789ec838e60891367b0096baf9a63392503ae567/merged) with podman image umount INFO: Removing image mock-bootstrap-3a3edbbf-72a5-4366-a5ce-62742ab317d0 INFO: Package manager dnf5 detected and used (fallback) INFO: Not updating bootstrap chroot, bootstrap_image_ready=True Start(bootstrap): creating root cache Finish(bootstrap): creating root cache Finish(bootstrap): chroot init Start: chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-rawhide-s390x-1734762221.542729/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start: cleaning package manager metadata Finish: cleaning package manager metadata INFO: enabled HW Info plugin INFO: Package manager dnf5 detected and used (direct choice) INFO: Buildroot is handled by package management downloaded with a bootstrap image: rpm-4.20.0-1.fc42.s390x rpm-sequoia-1.7.0-3.fc42.s390x dnf5-5.2.8.1-2.fc42.s390x dnf5-plugins-5.2.8.1-2.fc42.s390x Start: installing minimal buildroot with dnf5 Updating and loading repositories: fedora 100% | 5.8 KiB/s | 2.5 KiB | 00m00s Copr repository 100% | 4.3 KiB/s | 1.5 KiB | 00m00s Additional repo https_fedorapeople_org 100% | 4.7 KiB/s | 1.5 KiB | 00m00s Copr repository 100% | 1.1 MiB/s | 1.1 MiB | 00m01s Repositories loaded. Package Arch Version Repository Size Installing group/module packages: bash s390x 5.2.37-1.fc42 fedora 8.4 MiB bzip2 s390x 1.0.8-19.fc42 copr_base 84.4 KiB coreutils s390x 9.5-11.fc42 fedora 5.7 MiB cpio s390x 2.15-2.fc41 fedora 1.1 MiB diffutils s390x 3.10-8.fc41 fedora 1.6 MiB fedora-release-common noarch 42-0.11 fedora 19.8 KiB findutils s390x 1:4.10.0-4.fc41 fedora 1.9 MiB gawk s390x 5.3.0-4.fc41 fedora 1.8 MiB glibc-minimal-langpack s390x 2.40.9000-24.fc42 fedora 0.0 B grep s390x 3.11-9.fc41 fedora 1.0 MiB gzip s390x 1.13-2.fc41 fedora 400.8 KiB info s390x 7.1.1-2.fc42 fedora 409.1 KiB patch s390x 2.7.6-25.fc41 fedora 298.3 KiB redhat-rpm-config noarch 300-1.no_annobin.0.fc42 copr_base 186.6 KiB rpm-build s390x 4.20.0-1.fc42 fedora 200.4 KiB sed s390x 4.9-3.fc41 fedora 873.2 KiB shadow-utils s390x 2:4.17.0~rc1-1.fc42 fedora 4.0 MiB tar s390x 2:1.35-4.fc41 fedora 3.0 MiB unzip s390x 6.0-65.fc42 fedora 2.2 MiB util-linux s390x 2.40.2-8.fc42 fedora 3.7 MiB which s390x 2.21-42.fc41 fedora 83.9 KiB xz s390x 1:5.6.3-2.fc42 fedora 1.2 MiB Installing dependencies: add-determinism s390x 0.4.3-1.fc42 fedora 3.3 MiB alternatives s390x 1.31-1.fc42 fedora 60.6 KiB ansible-srpm-macros noarch 1-16.fc41 fedora 35.7 KiB audit-libs s390x 4.0.2-1.fc42 copr_base 342.9 KiB authselect s390x 1.5.0-8.fc42 copr_base 151.8 KiB authselect-libs s390x 1.5.0-8.fc42 copr_base 817.4 KiB basesystem noarch 11-21.fc41 fedora 0.0 B binutils s390x 2.43.50-9.fc42 copr_base 26.9 MiB build-reproducibility-srpm-macros noarch 0.4.3-1.fc42 fedora 735.0 B bzip2-libs s390x 1.0.8-19.fc42 copr_base 82.9 KiB ca-certificates noarch 2024.2.69_v8.0.401-3.fc42 fedora 2.6 MiB coreutils-common s390x 9.5-11.fc42 fedora 11.2 MiB cracklib s390x 2.9.11-6.fc41 fedora 250.0 KiB crypto-policies noarch 20241128-1.gitbb7b0b0.fc42 fedora 137.3 KiB curl s390x 8.11.1-2.fc42 fedora 475.8 KiB cyrus-sasl-lib s390x 2.1.28-27.fc41 fedora 2.4 MiB debugedit s390x 5.1-2.fc42 fedora 195.8 KiB dwz s390x 0.15-8.fc42 fedora 318.6 KiB ed s390x 1.20.2-2.fc41 fedora 150.6 KiB efi-srpm-macros noarch 5-13.fc42 fedora 40.2 KiB elfutils s390x 0.192-7.fc42 fedora 2.9 MiB elfutils-debuginfod-client s390x 0.192-7.fc42 fedora 73.0 KiB elfutils-default-yama-scope noarch 0.192-7.fc42 fedora 1.8 KiB elfutils-libelf s390x 0.192-7.fc42 fedora 1.2 MiB elfutils-libs s390x 0.192-7.fc42 fedora 746.5 KiB fedora-gpg-keys noarch 42-0.3 fedora 126.4 KiB fedora-release noarch 42-0.11 fedora 0.0 B fedora-release-identity-basic noarch 42-0.11 fedora 719.0 B fedora-repos noarch 42-0.3 fedora 4.9 KiB fedora-repos-rawhide noarch 42-0.3 fedora 2.2 KiB file s390x 5.45-8.fc42 fedora 99.3 KiB file-libs s390x 5.45-8.fc42 fedora 9.9 MiB filesystem s390x 3.18-29.fc42 fedora 106.0 B filesystem-srpm-macros noarch 3.18-29.fc42 fedora 36.1 KiB fonts-srpm-macros noarch 1:2.0.5-17.fc41 fedora 55.8 KiB forge-srpm-macros noarch 0.4.0-1.fc42 fedora 38.9 KiB fpc-srpm-macros noarch 1.3-13.fc41 fedora 144.0 B gdb-minimal s390x 15.2-4.fc42 fedora 14.7 MiB gdbm s390x 1:1.23-7.fc41 fedora 483.9 KiB gdbm-libs s390x 1:1.23-7.fc41 fedora 133.4 KiB ghc-srpm-macros noarch 1.9.2-1.fc42 fedora 779.0 B glibc s390x 2.40.9000-24.fc42 fedora 5.1 MiB glibc-common s390x 2.40.9000-24.fc42 fedora 1.1 MiB glibc-gconv-extra s390x 2.40.9000-24.fc42 fedora 6.5 MiB gmp s390x 1:6.3.0-2.fc41 fedora 770.0 KiB gnat-srpm-macros noarch 6-6.fc41 fedora 1.0 KiB go-srpm-macros noarch 3.6.0-5.fc42 fedora 60.8 KiB jansson s390x 2.14-1.fc42 fedora 92.9 KiB json-c s390x 0.18-1.fc42 fedora 82.9 KiB kernel-srpm-macros noarch 1.0-24.fc41 fedora 1.9 KiB keyutils-libs s390x 1.6.3-4.fc41 fedora 54.2 KiB krb5-libs s390x 1.21.3-3.fc42 fedora 2.4 MiB libacl s390x 2.3.2-2.fc42 copr_base 34.1 KiB libarchive s390x 3.7.7-1.fc42 fedora 1.0 MiB libattr s390x 2.5.2-4.fc41 fedora 28.3 KiB libblkid s390x 2.40.2-8.fc42 fedora 286.4 KiB libbrotli s390x 1.1.0-5.fc42 copr_base 903.7 KiB libcap s390x 2.71-1.fc42 fedora 211.8 KiB libcap-ng s390x 0.8.5-3.fc41 fedora 76.7 KiB libcom_err s390x 1.47.1-6.fc42 fedora 67.0 KiB libcurl s390x 8.11.1-2.fc42 fedora 861.0 KiB libeconf s390x 0.7.5-1.fc42 fedora 62.5 KiB libevent s390x 2.1.12-14.fc41 fedora 938.8 KiB libfdisk s390x 2.40.2-8.fc42 fedora 394.8 KiB libffi s390x 3.4.6-3.fc42 fedora 65.9 KiB libgcc s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 166.7 KiB libgomp s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 529.0 KiB libidn2 s390x 2.3.7-2.fc41 fedora 328.9 KiB libmount s390x 2.40.2-8.fc42 fedora 375.8 KiB libnghttp2 s390x 1.64.0-1.fc42 fedora 177.9 KiB libpkgconf s390x 2.3.0-1.fc42 fedora 85.9 KiB libpsl s390x 0.21.5-4.fc41 fedora 80.3 KiB libpwquality s390x 1.4.5-11.fc41 fedora 420.9 KiB libselinux s390x 3.8-0.rc3.1.fc42 fedora 203.4 KiB libsemanage s390x 3.8-0.rc3.1.fc42 fedora 305.1 KiB libsepol s390x 3.8-0.rc3.1.fc42 fedora 840.1 KiB libsmartcols s390x 2.40.2-8.fc42 fedora 192.2 KiB libssh s390x 0.11.1-1.fc42 fedora 585.3 KiB libssh-config noarch 0.11.1-1.fc42 fedora 277.0 B libstdc++ s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 3.1 MiB libtasn1 s390x 4.19.0-9.fc41 fedora 187.5 KiB libtirpc s390x 1.3.6-1.fc42 fedora 212.5 KiB libtool-ltdl s390x 2.5.4-1.fc42 copr_base 67.9 KiB libunistring s390x 1.1-8.fc41 fedora 1.8 MiB libuuid s390x 2.40.2-8.fc42 fedora 41.2 KiB libverto s390x 0.3.2-9.fc41 fedora 29.3 KiB libxcrypt s390x 4.4.36-11.fc42 fedora 271.2 KiB libxml2 s390x 2.12.8-2.fc41 fedora 1.9 MiB libzstd s390x 1.5.6-2.fc41 fedora 875.7 KiB lua-libs s390x 5.4.7-1.fc42 fedora 328.8 KiB lua-srpm-macros noarch 1-14.fc41 fedora 1.3 KiB lz4-libs s390x 1.10.0-1.fc41 fedora 201.3 KiB mpfr s390x 4.2.1-5.fc41 fedora 698.7 KiB ncurses-base noarch 6.5-2.20240629.fc41 fedora 326.3 KiB ncurses-libs s390x 6.5-2.20240629.fc41 fedora 1.1 MiB ocaml-srpm-macros noarch 10-3.fc41 fedora 1.9 KiB openblas-srpm-macros noarch 2-18.fc41 fedora 112.0 B openldap s390x 2.6.8-6.fc42 fedora 654.5 KiB openssl-libs s390x 1:3.2.2-8.fc42 fedora 6.1 MiB p11-kit s390x 0.25.5-4.fc42 fedora 2.5 MiB p11-kit-trust s390x 0.25.5-4.fc42 fedora 479.2 KiB package-notes-srpm-macros noarch 0.5-12.fc41 fedora 1.6 KiB pam s390x 1.7.0-3.fc42 fedora 1.5 MiB pam-libs s390x 1.7.0-3.fc42 fedora 122.5 KiB pcre2 s390x 10.44-1.fc41.1 fedora 684.9 KiB pcre2-syntax noarch 10.44-1.fc41.1 fedora 251.6 KiB perl-srpm-macros noarch 1-56.fc41 fedora 861.0 B pkgconf s390x 2.3.0-1.fc42 fedora 92.4 KiB pkgconf-m4 noarch 2.3.0-1.fc42 fedora 14.4 KiB pkgconf-pkg-config s390x 2.3.0-1.fc42 fedora 988.0 B popt s390x 1.19-7.fc41 fedora 144.7 KiB publicsuffix-list-dafsa noarch 20240107-4.fc41 fedora 67.5 KiB pyproject-srpm-macros noarch 1.16.3-1.fc42 fedora 1.9 KiB python-srpm-macros noarch 3.13-3.fc41 fedora 51.0 KiB qt5-srpm-macros noarch 5.15.15-1.fc42 fedora 500.0 B qt6-srpm-macros noarch 6.8.1-4.fc42 fedora 456.0 B readline s390x 8.2-11.fc42 fedora 556.8 KiB rpm s390x 4.20.0-1.fc42 fedora 3.1 MiB rpm-build-libs s390x 4.20.0-1.fc42 fedora 218.4 KiB rpm-libs s390x 4.20.0-1.fc42 fedora 813.6 KiB rpm-sequoia s390x 1.7.0-3.fc42 fedora 3.2 MiB rust-srpm-macros noarch 26.3-3.fc42 fedora 4.8 KiB setup noarch 2.15.0-5.fc41 fedora 720.7 KiB sqlite-libs s390x 3.47.2-1.fc42 fedora 1.6 MiB systemd-libs s390x 257-1.fc42 fedora 2.2 MiB util-linux-core s390x 2.40.2-8.fc42 fedora 1.5 MiB xxhash-libs s390x 0.8.2-4.fc42 fedora 68.0 KiB xz-libs s390x 1:5.6.3-2.fc42 fedora 226.1 KiB zig-srpm-macros noarch 1-3.fc41 fedora 1.1 KiB zip s390x 3.0-42.fc42 fedora 723.1 KiB zlib-ng-compat s390x 2.2.2-1.fc42 fedora 109.4 KiB zstd s390x 1.5.6-2.fc41 fedora 1.8 MiB Installing groups: Buildsystem building group Transaction Summary: Installing: 154 packages Total size of inbound packages is 53 MiB. Need to download 0 B. After this operation, 183 MiB extra will be used (install 183 MiB, remove 0 B). [1/1] tar-2:1.35-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [1/1] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/2] rpm-build-0:4.20.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [2/2] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/3] unzip-0:6.0-65.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [3/3] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/4] cpio-0:2.15-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [4/4] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/5] which-0:2.21-42.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [5/5] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/6] bash-0:5.2.37-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [6/6] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/7] coreutils-0:9.5-11.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [7/7] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/8] grep-0:3.11-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [8/8] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/9] patch-0:2.7.6-25.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [9/9] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/10] sed-0:4.9-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [10/10] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/11] shadow-utils-2:4.17.0~rc1-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [11/11] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/12] util-linux-0:2.40.2-8.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [12/12] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/13] diffutils-0:3.10-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [13/13] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/14] fedora-release-common-0:42-0.11 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [14/14] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/15] findutils-1:4.10.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [15/15] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/16] gawk-0:5.3.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [16/16] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/17] glibc-minimal-langpack-0:2.40.9 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [17/17] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/18] gzip-0:1.13-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [18/18] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/19] info-0:7.1.1-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [19/19] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/20] xz-1:5.6.3-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [20/20] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/21] bzip2-0:1.0.8-19.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [21/21] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/22] redhat-rpm-config-0:300-1.no_an 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [22/22] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/23] glibc-0:2.40.9000-24.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [23/23] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/24] libselinux-0:3.8-0.rc3.1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [24/24] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/25] debugedit-0:5.1-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [25/25] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/26] elfutils-0:0.192-7.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [26/26] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/27] elfutils-libelf-0:0.192-7.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [27/27] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/28] file-0:5.45-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [28/28] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/29] libarchive-0:3.7.7-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [29/29] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/30] pkgconf-pkg-config-0:2.3.0-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [30/30] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/31] popt-0:1.19-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [31/31] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/32] readline-0:8.2-11.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [32/32] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/33] rpm-0:4.20.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [33/33] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/34] rpm-build-libs-0:4.20.0-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [34/34] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/35] rpm-libs-0:4.20.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [35/35] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/36] zstd-0:1.5.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [36/36] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/37] filesystem-0:3.18-29.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [37/37] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/38] ncurses-libs-0:6.5-2.20240629.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [38/38] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/39] coreutils-common-0:9.5-11.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [39/39] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/40] gmp-1:6.3.0-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [40/40] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/41] libattr-0:2.5.2-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [41/41] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/42] libcap-0:2.71-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [42/42] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/43] openssl-libs-1:3.2.2-8.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [43/43] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/44] systemd-libs-0:257-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [44/44] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/45] pcre2-0:10.44-1.fc41.1.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [45/45] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/46] ed-0:1.20.2-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [46/46] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/47] libeconf-0:0.7.5-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [47/47] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/48] libsemanage-0:3.8-0.rc3.1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [48/48] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/49] libxcrypt-0:4.4.36-11.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [49/49] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/50] pam-libs-0:1.7.0-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [50/50] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/51] setup-0:2.15.0-5.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [51/51] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/52] libblkid-0:2.40.2-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [52/52] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/53] libcap-ng-0:0.8.5-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [53/53] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/54] libfdisk-0:2.40.2-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [54/54] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/55] libmount-0:2.40.2-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [55/55] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/56] libsmartcols-0:2.40.2-8.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [56/56] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/57] libuuid-0:2.40.2-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [57/57] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/58] pam-0:1.7.0-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [58/58] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/59] util-linux-core-0:2.40.2-8.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [59/59] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/60] zlib-ng-compat-0:2.2.2-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [60/60] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/61] fedora-repos-0:42-0.3.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [61/61] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/62] mpfr-0:4.2.1-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [62/62] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/63] glibc-common-0:2.40.9000-24.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [63/63] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/64] xz-libs-1:5.6.3-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [64/64] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/65] ansible-srpm-macros-0:1-16.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [65/65] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/66] build-reproducibility-srpm-macr 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [66/66] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/67] dwz-0:0.15-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [67/67] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/68] efi-srpm-macros-0:5-13.fc42.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [68/68] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/69] filesystem-srpm-macros-0:3.18-2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [69/69] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/70] fonts-srpm-macros-1:2.0.5-17.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [70/70] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/71] forge-srpm-macros-0:0.4.0-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [71/71] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/72] fpc-srpm-macros-0:1.3-13.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [72/72] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/73] ghc-srpm-macros-0:1.9.2-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [73/73] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/74] gnat-srpm-macros-0:6-6.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [74/74] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/75] go-srpm-macros-0:3.6.0-5.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [75/75] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/76] kernel-srpm-macros-0:1.0-24.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [76/76] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/77] lua-srpm-macros-0:1-14.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [77/77] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/78] ocaml-srpm-macros-0:10-3.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [78/78] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/79] openblas-srpm-macros-0:2-18.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [79/79] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/80] package-notes-srpm-macros-0:0.5 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [80/80] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/81] perl-srpm-macros-0:1-56.fc41.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [81/81] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/82] pyproject-srpm-macros-0:1.16.3- 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [82/82] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/83] python-srpm-macros-0:3.13-3.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [83/83] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/84] qt5-srpm-macros-0:5.15.15-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [84/84] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/85] qt6-srpm-macros-0:6.8.1-4.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [85/85] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/86] rust-srpm-macros-0:26.3-3.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [86/86] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/87] zig-srpm-macros-0:1-3.fc41.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [87/87] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/88] zip-0:3.0-42.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [88/88] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/89] glibc-gconv-extra-0:2.40.9000-2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [89/89] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/90] basesystem-0:11-21.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [90/90] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/91] libsepol-0:3.8-0.rc3.1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [91/91] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/92] elfutils-libs-0:0.192-7.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [92/92] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/93] elfutils-debuginfod-client-0:0. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [93/93] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/94] libzstd-0:1.5.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [94/94] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/95] file-libs-0:5.45-8.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [95/95] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/96] libxml2-0:2.12.8-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [96/96] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/97] lz4-libs-0:1.10.0-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [97/97] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/98] pkgconf-0:2.3.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [98/98] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/99] pkgconf-m4-0:2.3.0-1.fc42.noarc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [99/99] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/100] curl-0:8.11.1-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [100/100] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/101] lua-libs-0:5.4.7-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [101/101] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/102] rpm-sequoia-0:1.7.0-3.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [102/102] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/103] sqlite-libs-0:3.47.2-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [103/103] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/104] ncurses-base-0:6.5-2.20240629 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [104/104] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/105] ca-certificates-0:2024.2.69_v 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [105/105] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/106] crypto-policies-0:20241128-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [106/106] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/107] pcre2-syntax-0:10.44-1.fc41.1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [107/107] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/108] gdbm-1:1.23-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [108/108] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/109] gdbm-libs-1:1.23-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [109/109] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/110] libpwquality-0:1.4.5-11.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [110/110] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/111] libtirpc-0:1.3.6-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [111/111] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/112] fedora-gpg-keys-0:42-0.3.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [112/112] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/113] fedora-repos-rawhide-0:42-0.3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [113/113] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/114] add-determinism-0:0.4.3-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [114/114] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/115] elfutils-default-yama-scope-0 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [115/115] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/116] json-c-0:0.18-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [116/116] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/117] libpkgconf-0:2.3.0-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [117/117] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/118] libffi-0:3.4.6-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [118/118] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/119] p11-kit-0:0.25.5-4.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [119/119] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/120] p11-kit-trust-0:0.25.5-4.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [120/120] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/121] cracklib-0:2.9.11-6.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [121/121] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/122] krb5-libs-0:1.21.3-3.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [122/122] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/123] libcom_err-0:1.47.1-6.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [123/123] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/124] libtasn1-0:4.19.0-9.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [124/124] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/125] keyutils-libs-0:1.6.3-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [125/125] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/126] libverto-0:0.3.2-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [126/126] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/127] bzip2-libs-0:1.0.8-19.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [127/127] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/128] libgcc-0:15.0.0-0.2.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [128/128] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/129] libstdc++-0:15.0.0-0.2.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [129/129] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/130] audit-libs-0:4.0.2-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [130/130] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/131] authselect-libs-0:1.5.0-8.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [131/131] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/132] libacl-0:2.3.2-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [132/132] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/133] libgomp-0:15.0.0-0.2.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [133/133] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/134] binutils-0:2.43.50-9.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [134/134] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/135] jansson-0:2.14-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [135/135] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/136] authselect-0:1.5.0-8.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [136/136] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/137] alternatives-0:1.31-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [137/137] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/138] fedora-release-0:42-0.11.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [138/138] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/139] gdb-minimal-0:15.2-4.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [139/139] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/140] xxhash-libs-0:0.8.2-4.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [140/140] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/141] fedora-release-identity-basic 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [141/141] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/142] libcurl-0:8.11.1-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [142/142] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/143] libidn2-0:2.3.7-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [143/143] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/144] libnghttp2-0:1.64.0-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [144/144] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/145] libpsl-0:0.21.5-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [145/145] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/146] libssh-0:0.11.1-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [146/146] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/147] openldap-0:2.6.8-6.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [147/147] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/148] libunistring-0:1.1-8.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [148/148] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/149] publicsuffix-list-dafsa-0:202 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [149/149] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/150] libssh-config-0:0.11.1-1.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [150/150] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/151] cyrus-sasl-lib-0:2.1.28-27.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [151/151] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/152] libevent-0:2.1.12-14.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [152/152] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/153] libtool-ltdl-0:2.5.4-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [153/153] Total 100% | 0.0 B/s | 0.0 B | 00m00s [ 1/154] libbrotli-0:1.1.0-5.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [154/154] Total 100% | 0.0 B/s | 0.0 B | 00m00s Running transaction Importing OpenPGP key 0x105EF944: UserID : "Fedora (42) " Fingerprint: B0F4950458F69E1150C6C5EDC8AC4916105EF944 From : file:///usr/share/distribution-gpg-keys/fedora/RPM-GPG-KEY-fedora-42-primary The key was successfully imported. Importing OpenPGP key 0x105EF944: UserID : "Fedora (42) " Fingerprint: B0F4950458F69E1150C6C5EDC8AC4916105EF944 From : file:///usr/share/distribution-gpg-keys/fedora/RPM-GPG-KEY-fedora-42-primary The key was successfully imported. Importing OpenPGP key 0xE99D6AD1: UserID : "Fedora (41) " Fingerprint: 466CF2D8B60BC3057AA9453ED0622462E99D6AD1 From : file:///usr/share/distribution-gpg-keys/fedora/RPM-GPG-KEY-fedora-41-primary The key was successfully imported. Importing OpenPGP key 0x31645531: UserID : "Fedora (43) " Fingerprint: C6E7F081CF80E13146676E88829B606631645531 From : file:///usr/share/distribution-gpg-keys/fedora/RPM-GPG-KEY-fedora-43-primary The key was successfully imported. [ 1/156] Verify package files 100% | 777.0 B/s | 154.0 B | 00m00s >>> Running pre-transaction scriptlet: filesystem-0:3.18-29.fc42.s390x >>> Finished pre-transaction scriptlet: filesystem-0:3.18-29.fc42.s390x >>> [RPM] /var/lib/mock/fedora-rawhide-s390x-1734762221.542729/root/var/cache/dn [ 2/156] Prepare transaction 100% | 2.9 KiB/s | 154.0 B | 00m00s [ 3/156] Installing libgcc-0:15.0.0-0. 100% | 82.2 MiB/s | 168.4 KiB | 00m00s [ 4/156] Installing libssh-config-0:0. 100% | 0.0 B/s | 816.0 B | 00m00s [ 5/156] Installing publicsuffix-list- 100% | 0.0 B/s | 68.3 KiB | 00m00s [ 6/156] Installing fedora-release-ide 100% | 0.0 B/s | 976.0 B | 00m00s [ 7/156] Installing fedora-gpg-keys-0: 100% | 42.0 MiB/s | 172.2 KiB | 00m00s [ 8/156] Installing fedora-repos-rawhi 100% | 0.0 B/s | 2.4 KiB | 00m00s [ 9/156] Installing fedora-repos-0:42- 100% | 0.0 B/s | 5.7 KiB | 00m00s [ 10/156] Installing fedora-release-com 100% | 23.6 MiB/s | 24.1 KiB | 00m00s [ 11/156] Installing fedora-release-0:4 100% | 0.0 B/s | 124.0 B | 00m00s [ 12/156] Installing setup-0:2.15.0-5.f 100% | 50.6 MiB/s | 726.1 KiB | 00m00s >>> [RPM] /etc/hosts created as /etc/hosts.rpmnew [ 13/156] Installing filesystem-0:3.18- 100% | 3.1 MiB/s | 212.6 KiB | 00m00s [ 14/156] Installing basesystem-0:11-21 100% | 0.0 B/s | 124.0 B | 00m00s [ 15/156] Installing pcre2-syntax-0:10. 100% | 248.1 MiB/s | 254.1 KiB | 00m00s [ 16/156] Installing ncurses-base-0:6.5 100% | 85.9 MiB/s | 351.7 KiB | 00m00s [ 17/156] Installing glibc-minimal-lang 100% | 0.0 B/s | 124.0 B | 00m00s [ 18/156] Installing ncurses-libs-0:6.5 100% | 177.1 MiB/s | 1.1 MiB | 00m00s [ 19/156] Installing glibc-0:2.40.9000- 100% | 230.8 MiB/s | 5.1 MiB | 00m00s [ 20/156] Installing bash-0:5.2.37-1.fc 100% | 350.1 MiB/s | 8.4 MiB | 00m00s [ 21/156] Installing glibc-common-0:2.4 100% | 152.4 MiB/s | 1.1 MiB | 00m00s [ 22/156] Installing glibc-gconv-extra- 100% | 228.5 MiB/s | 6.6 MiB | 00m00s [ 23/156] Installing zlib-ng-compat-0:2 100% | 107.7 MiB/s | 110.3 KiB | 00m00s [ 24/156] Installing xz-libs-1:5.6.3-2. 100% | 221.9 MiB/s | 227.2 KiB | 00m00s [ 25/156] Installing bzip2-libs-0:1.0.8 100% | 0.0 B/s | 84.0 KiB | 00m00s [ 26/156] Installing popt-0:1.19-7.fc41 100% | 73.9 MiB/s | 151.3 KiB | 00m00s [ 27/156] Installing readline-0:8.2-11. 100% | 272.9 MiB/s | 558.9 KiB | 00m00s [ 28/156] Installing libuuid-0:2.40.2-8 100% | 0.0 B/s | 42.3 KiB | 00m00s [ 29/156] Installing libblkid-0:2.40.2- 100% | 280.8 MiB/s | 287.6 KiB | 00m00s [ 30/156] Installing gmp-1:6.3.0-2.fc41 100% | 251.4 MiB/s | 772.2 KiB | 00m00s [ 31/156] Installing libattr-0:2.5.2-4. 100% | 0.0 B/s | 29.3 KiB | 00m00s [ 32/156] Installing libacl-0:2.3.2-2.f 100% | 0.0 B/s | 34.9 KiB | 00m00s [ 33/156] Installing libxcrypt-0:4.4.36 100% | 267.5 MiB/s | 273.9 KiB | 00m00s [ 34/156] Installing libzstd-0:1.5.6-2. 100% | 285.5 MiB/s | 877.0 KiB | 00m00s [ 35/156] Installing elfutils-libelf-0: 100% | 391.6 MiB/s | 1.2 MiB | 00m00s [ 36/156] Installing libstdc++-0:15.0.0 100% | 307.5 MiB/s | 3.1 MiB | 00m00s [ 37/156] Installing libeconf-0:0.7.5-1 100% | 62.6 MiB/s | 64.2 KiB | 00m00s [ 38/156] Installing gdbm-libs-1:1.23-7 100% | 132.0 MiB/s | 135.1 KiB | 00m00s [ 39/156] Installing dwz-0:0.15-8.fc42. 100% | 312.5 MiB/s | 320.0 KiB | 00m00s [ 40/156] Installing mpfr-0:4.2.1-5.fc4 100% | 228.0 MiB/s | 700.4 KiB | 00m00s [ 41/156] Installing gawk-0:5.3.0-4.fc4 100% | 259.2 MiB/s | 1.8 MiB | 00m00s [ 42/156] Installing unzip-0:6.0-65.fc4 100% | 736.0 MiB/s | 2.2 MiB | 00m00s [ 43/156] Installing file-libs-0:5.45-8 100% | 621.4 MiB/s | 9.9 MiB | 00m00s [ 44/156] Installing file-0:5.45-8.fc42 100% | 16.4 MiB/s | 100.8 KiB | 00m00s [ 45/156] Installing crypto-policies-0: 100% | 32.0 MiB/s | 163.7 KiB | 00m00s [ 46/156] Installing pcre2-0:10.44-1.fc 100% | 223.4 MiB/s | 686.3 KiB | 00m00s [ 47/156] Installing grep-0:3.11-9.fc41 100% | 203.7 MiB/s | 1.0 MiB | 00m00s [ 48/156] Installing xz-1:5.6.3-2.fc42. 100% | 206.8 MiB/s | 1.2 MiB | 00m00s [ 49/156] Installing libcap-ng-0:0.8.5- 100% | 76.7 MiB/s | 78.6 KiB | 00m00s [ 50/156] Installing audit-libs-0:4.0.2 100% | 168.4 MiB/s | 345.0 KiB | 00m00s [ 51/156] Installing pam-libs-0:1.7.0-3 100% | 121.8 MiB/s | 124.8 KiB | 00m00s [ 52/156] Installing libcap-0:2.71-1.fc 100% | 105.8 MiB/s | 216.7 KiB | 00m00s [ 53/156] Installing systemd-libs-0:257 100% | 249.5 MiB/s | 2.2 MiB | 00m00s [ 54/156] Installing libsmartcols-0:2.4 100% | 188.7 MiB/s | 193.2 KiB | 00m00s [ 55/156] Installing libsepol-0:3.8-0.r 100% | 273.8 MiB/s | 841.0 KiB | 00m00s [ 56/156] Installing libselinux-0:3.8-0 100% | 199.9 MiB/s | 204.7 KiB | 00m00s [ 57/156] Installing sed-0:4.9-3.fc41.s 100% | 215.2 MiB/s | 881.4 KiB | 00m00s [ 58/156] Installing findutils-1:4.10.0 100% | 270.4 MiB/s | 1.9 MiB | 00m00s [ 59/156] Installing libmount-0:2.40.2- 100% | 184.0 MiB/s | 376.9 KiB | 00m00s [ 60/156] Installing lz4-libs-0:1.10.0- 100% | 197.6 MiB/s | 202.4 KiB | 00m00s [ 61/156] Installing lua-libs-0:5.4.7-1 100% | 322.3 MiB/s | 330.0 KiB | 00m00s [ 62/156] Installing libffi-0:3.4.6-3.f 100% | 0.0 B/s | 67.3 KiB | 00m00s [ 63/156] Installing libcom_err-0:1.47. 100% | 0.0 B/s | 68.0 KiB | 00m00s [ 64/156] Installing libtasn1-0:4.19.0- 100% | 184.9 MiB/s | 189.3 KiB | 00m00s [ 65/156] Installing p11-kit-0:0.25.5-4 100% | 251.2 MiB/s | 2.5 MiB | 00m00s [ 66/156] Installing alternatives-0:1.3 100% | 0.0 B/s | 62.2 KiB | 00m00s [ 67/156] Installing libunistring-0:1.1 100% | 295.6 MiB/s | 1.8 MiB | 00m00s [ 68/156] Installing libidn2-0:2.3.7-2. 100% | 163.5 MiB/s | 334.9 KiB | 00m00s [ 69/156] Installing libpsl-0:0.21.5-4. 100% | 0.0 B/s | 81.4 KiB | 00m00s [ 70/156] Installing p11-kit-trust-0:0. 100% | 78.3 MiB/s | 480.9 KiB | 00m00s [ 71/156] Installing zstd-0:1.5.6-2.fc4 100% | 262.1 MiB/s | 1.8 MiB | 00m00s [ 72/156] Installing util-linux-core-0: 100% | 220.5 MiB/s | 1.5 MiB | 00m00s [ 73/156] Installing tar-2:1.35-4.fc41. 100% | 302.0 MiB/s | 3.0 MiB | 00m00s [ 74/156] Installing libsemanage-0:3.8- 100% | 99.9 MiB/s | 306.9 KiB | 00m00s [ 75/156] Installing shadow-utils-2:4.1 100% | 212.9 MiB/s | 4.0 MiB | 00m00s [ 76/156] Installing zip-0:3.0-42.fc42. 100% | 236.7 MiB/s | 727.0 KiB | 00m00s [ 77/156] Installing gdbm-1:1.23-7.fc41 100% | 238.7 MiB/s | 488.8 KiB | 00m00s [ 78/156] Installing cyrus-sasl-lib-0:2 100% | 298.6 MiB/s | 2.4 MiB | 00m00s [ 79/156] Installing libfdisk-0:2.40.2- 100% | 193.3 MiB/s | 395.9 KiB | 00m00s [ 80/156] Installing bzip2-0:1.0.8-19.f 100% | 86.8 MiB/s | 88.9 KiB | 00m00s [ 81/156] Installing libxml2-0:2.12.8-2 100% | 268.5 MiB/s | 1.9 MiB | 00m00s [ 82/156] Installing sqlite-libs-0:3.47 100% | 264.5 MiB/s | 1.6 MiB | 00m00s [ 83/156] Installing add-determinism-0: 100% | 299.0 MiB/s | 3.3 MiB | 00m00s [ 84/156] Installing build-reproducibil 100% | 0.0 B/s | 1.0 KiB | 00m00s [ 85/156] Installing ed-0:1.20.2-2.fc41 100% | 149.3 MiB/s | 152.9 KiB | 00m00s [ 86/156] Installing patch-0:2.7.6-25.f 100% | 292.8 MiB/s | 299.9 KiB | 00m00s [ 87/156] Installing filesystem-srpm-ma 100% | 0.0 B/s | 36.8 KiB | 00m00s [ 88/156] Installing elfutils-default-y 100% | 681.0 KiB/s | 2.0 KiB | 00m00s [ 89/156] Installing elfutils-libs-0:0. 100% | 182.7 MiB/s | 748.4 KiB | 00m00s [ 90/156] Installing cpio-0:2.15-2.fc41 100% | 223.8 MiB/s | 1.1 MiB | 00m00s [ 91/156] Installing diffutils-0:3.10-8 100% | 271.4 MiB/s | 1.6 MiB | 00m00s [ 92/156] Installing json-c-0:0.18-1.fc 100% | 82.2 MiB/s | 84.1 KiB | 00m00s [ 93/156] Installing libpkgconf-0:2.3.0 100% | 0.0 B/s | 87.0 KiB | 00m00s [ 94/156] Installing pkgconf-0:2.3.0-1. 100% | 92.7 MiB/s | 94.9 KiB | 00m00s [ 95/156] Installing keyutils-libs-0:1. 100% | 0.0 B/s | 55.6 KiB | 00m00s [ 96/156] Installing libverto-0:0.3.2-9 100% | 30.3 MiB/s | 31.1 KiB | 00m00s [ 97/156] Installing libgomp-0:15.0.0-0 100% | 259.0 MiB/s | 530.4 KiB | 00m00s [ 98/156] Installing jansson-0:2.14-1.f 100% | 92.1 MiB/s | 94.3 KiB | 00m00s [ 99/156] Installing xxhash-libs-0:0.8. 100% | 0.0 B/s | 69.4 KiB | 00m00s [100/156] Installing libnghttp2-0:1.64. 100% | 174.9 MiB/s | 179.1 KiB | 00m00s [101/156] Installing libtool-ltdl-0:2.5 100% | 0.0 B/s | 69.0 KiB | 00m00s [102/156] Installing libbrotli-0:1.1.0- 100% | 221.2 MiB/s | 906.0 KiB | 00m00s [103/156] Installing pkgconf-m4-0:2.3.0 100% | 0.0 B/s | 14.8 KiB | 00m00s [104/156] Installing pkgconf-pkg-config 100% | 0.0 B/s | 1.8 KiB | 00m00s [105/156] Installing rust-srpm-macros-0 100% | 0.0 B/s | 5.6 KiB | 00m00s [106/156] Installing qt6-srpm-macros-0: 100% | 0.0 B/s | 732.0 B | 00m00s [107/156] Installing qt5-srpm-macros-0: 100% | 0.0 B/s | 776.0 B | 00m00s [108/156] Installing perl-srpm-macros-0 100% | 0.0 B/s | 1.1 KiB | 00m00s [109/156] Installing package-notes-srpm 100% | 0.0 B/s | 2.0 KiB | 00m00s [110/156] Installing openblas-srpm-macr 100% | 0.0 B/s | 392.0 B | 00m00s [111/156] Installing ocaml-srpm-macros- 100% | 0.0 B/s | 2.2 KiB | 00m00s [112/156] Installing kernel-srpm-macros 100% | 0.0 B/s | 2.3 KiB | 00m00s [113/156] Installing gnat-srpm-macros-0 100% | 0.0 B/s | 1.3 KiB | 00m00s [114/156] Installing ghc-srpm-macros-0: 100% | 0.0 B/s | 1.0 KiB | 00m00s [115/156] Installing fpc-srpm-macros-0: 100% | 0.0 B/s | 420.0 B | 00m00s [116/156] Installing ansible-srpm-macro 100% | 35.4 MiB/s | 36.2 KiB | 00m00s [117/156] Installing coreutils-common-0 100% | 339.1 MiB/s | 11.2 MiB | 00m00s [118/156] Installing openssl-libs-1:3.2 100% | 292.5 MiB/s | 6.1 MiB | 00m00s [119/156] Installing coreutils-0:9.5-11 100% | 249.0 MiB/s | 5.7 MiB | 00m00s [120/156] Installing ca-certificates-0: 100% | 1.7 MiB/s | 2.4 MiB | 00m01s [121/156] Installing krb5-libs-0:1.21.3 100% | 219.8 MiB/s | 2.4 MiB | 00m00s [122/156] Installing libarchive-0:3.7.7 100% | 249.5 MiB/s | 1.0 MiB | 00m00s [123/156] Installing gzip-0:1.13-2.fc41 100% | 198.4 MiB/s | 406.3 KiB | 00m00s [124/156] Installing authselect-libs-0: 100% | 162.6 MiB/s | 832.3 KiB | 00m00s [125/156] Installing cracklib-0:2.9.11- 100% | 85.1 MiB/s | 261.4 KiB | 00m00s [126/156] Installing libpwquality-0:1.4 100% | 141.0 MiB/s | 433.3 KiB | 00m00s [127/156] Installing libtirpc-0:1.3.6-1 100% | 104.6 MiB/s | 214.3 KiB | 00m00s [128/156] Installing pam-0:1.7.0-3.fc42 100% | 132.8 MiB/s | 1.6 MiB | 00m00s [129/156] Installing libssh-0:0.11.1-1. 100% | 191.2 MiB/s | 587.4 KiB | 00m00s [130/156] Installing rpm-sequoia-0:1.7. 100% | 287.3 MiB/s | 3.2 MiB | 00m00s [131/156] Installing rpm-libs-0:4.20.0- 100% | 265.3 MiB/s | 815.1 KiB | 00m00s [132/156] Installing rpm-build-libs-0:4 100% | 214.1 MiB/s | 219.3 KiB | 00m00s [133/156] Installing libevent-0:2.1.12- 100% | 306.8 MiB/s | 942.6 KiB | 00m00s [134/156] Installing openldap-0:2.6.8-6 100% | 214.3 MiB/s | 658.3 KiB | 00m00s [135/156] Installing libcurl-0:8.11.1-2 100% | 210.5 MiB/s | 862.1 KiB | 00m00s [136/156] Installing elfutils-debuginfo 100% | 73.5 MiB/s | 75.3 KiB | 00m00s [137/156] Installing elfutils-0:0.192-7 100% | 325.6 MiB/s | 2.9 MiB | 00m00s [138/156] Installing binutils-0:2.43.50 100% | 324.6 MiB/s | 26.9 MiB | 00m00s [139/156] Installing gdb-minimal-0:15.2 100% | 306.3 MiB/s | 14.7 MiB | 00m00s [140/156] Installing debugedit-0:5.1-2. 100% | 193.9 MiB/s | 198.5 KiB | 00m00s [141/156] Installing curl-0:8.11.1-2.fc 100% | 58.4 MiB/s | 478.3 KiB | 00m00s [142/156] Installing rpm-0:4.20.0-1.fc4 100% | 167.0 MiB/s | 2.5 MiB | 00m00s [143/156] Installing efi-srpm-macros-0: 100% | 40.2 MiB/s | 41.2 KiB | 00m00s [144/156] Installing lua-srpm-macros-0: 100% | 0.0 B/s | 1.9 KiB | 00m00s [145/156] Installing zig-srpm-macros-0: 100% | 0.0 B/s | 1.7 KiB | 00m00s [146/156] Installing fonts-srpm-macros- 100% | 0.0 B/s | 57.0 KiB | 00m00s [147/156] Installing forge-srpm-macros- 100% | 0.0 B/s | 40.3 KiB | 00m00s [148/156] Installing go-srpm-macros-0:3 100% | 0.0 B/s | 62.0 KiB | 00m00s [149/156] Installing python-srpm-macros 100% | 0.0 B/s | 52.2 KiB | 00m00s [150/156] Installing redhat-rpm-config- 100% | 94.3 MiB/s | 193.2 KiB | 00m00s [151/156] Installing rpm-build-0:4.20.0 100% | 102.0 MiB/s | 209.0 KiB | 00m00s [152/156] Installing pyproject-srpm-mac 100% | 1.2 MiB/s | 2.5 KiB | 00m00s [153/156] Installing util-linux-0:2.40. 100% | 169.5 MiB/s | 3.7 MiB | 00m00s [154/156] Installing authselect-0:1.5.0 100% | 76.3 MiB/s | 156.2 KiB | 00m00s [155/156] Installing which-0:2.21-42.fc 100% | 84.1 MiB/s | 86.1 KiB | 00m00s [156/156] Installing info-0:7.1.1-2.fc4 100% | 235.6 KiB/s | 409.5 KiB | 00m02s Warning: skipped OpenPGP checks for 13 packages from repositories: copr_base, https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch Complete! Finish: installing minimal buildroot with dnf5 Start: creating root cache Finish: creating root cache Finish: chroot init INFO: Installed packages: INFO: add-determinism-0.4.3-1.fc42.s390x alternatives-1.31-1.fc42.s390x ansible-srpm-macros-1-16.fc41.noarch audit-libs-4.0.2-1.fc42.s390x authselect-1.5.0-8.fc42.s390x authselect-libs-1.5.0-8.fc42.s390x basesystem-11-21.fc41.noarch bash-5.2.37-1.fc42.s390x binutils-2.43.50-9.fc42.s390x build-reproducibility-srpm-macros-0.4.3-1.fc42.noarch bzip2-1.0.8-19.fc42.s390x bzip2-libs-1.0.8-19.fc42.s390x ca-certificates-2024.2.69_v8.0.401-3.fc42.noarch coreutils-9.5-11.fc42.s390x coreutils-common-9.5-11.fc42.s390x cpio-2.15-2.fc41.s390x cracklib-2.9.11-6.fc41.s390x crypto-policies-20241128-1.gitbb7b0b0.fc42.noarch curl-8.11.1-2.fc42.s390x cyrus-sasl-lib-2.1.28-27.fc41.s390x debugedit-5.1-2.fc42.s390x diffutils-3.10-8.fc41.s390x dwz-0.15-8.fc42.s390x ed-1.20.2-2.fc41.s390x efi-srpm-macros-5-13.fc42.noarch elfutils-0.192-7.fc42.s390x elfutils-debuginfod-client-0.192-7.fc42.s390x elfutils-default-yama-scope-0.192-7.fc42.noarch elfutils-libelf-0.192-7.fc42.s390x elfutils-libs-0.192-7.fc42.s390x fedora-gpg-keys-42-0.3.noarch fedora-release-42-0.11.noarch fedora-release-common-42-0.11.noarch fedora-release-identity-basic-42-0.11.noarch fedora-repos-42-0.3.noarch fedora-repos-rawhide-42-0.3.noarch file-5.45-8.fc42.s390x file-libs-5.45-8.fc42.s390x filesystem-3.18-29.fc42.s390x filesystem-srpm-macros-3.18-29.fc42.noarch findutils-4.10.0-4.fc41.s390x fonts-srpm-macros-2.0.5-17.fc41.noarch forge-srpm-macros-0.4.0-1.fc42.noarch fpc-srpm-macros-1.3-13.fc41.noarch gawk-5.3.0-4.fc41.s390x gdb-minimal-15.2-4.fc42.s390x gdbm-1.23-7.fc41.s390x gdbm-libs-1.23-7.fc41.s390x ghc-srpm-macros-1.9.2-1.fc42.noarch glibc-2.40.9000-24.fc42.s390x glibc-common-2.40.9000-24.fc42.s390x glibc-gconv-extra-2.40.9000-24.fc42.s390x glibc-minimal-langpack-2.40.9000-24.fc42.s390x gmp-6.3.0-2.fc41.s390x gnat-srpm-macros-6-6.fc41.noarch go-srpm-macros-3.6.0-5.fc42.noarch gpg-pubkey-105ef944-65ca83d1 gpg-pubkey-31645531-66b6dccf gpg-pubkey-e99d6ad1-64d2612c grep-3.11-9.fc41.s390x gzip-1.13-2.fc41.s390x info-7.1.1-2.fc42.s390x jansson-2.14-1.fc42.s390x json-c-0.18-1.fc42.s390x kernel-srpm-macros-1.0-24.fc41.noarch keyutils-libs-1.6.3-4.fc41.s390x krb5-libs-1.21.3-3.fc42.s390x libacl-2.3.2-2.fc42.s390x libarchive-3.7.7-1.fc42.s390x libattr-2.5.2-4.fc41.s390x libblkid-2.40.2-8.fc42.s390x libbrotli-1.1.0-5.fc42.s390x libcap-2.71-1.fc42.s390x libcap-ng-0.8.5-3.fc41.s390x libcom_err-1.47.1-6.fc42.s390x libcurl-8.11.1-2.fc42.s390x libeconf-0.7.5-1.fc42.s390x libevent-2.1.12-14.fc41.s390x libfdisk-2.40.2-8.fc42.s390x libffi-3.4.6-3.fc42.s390x libgcc-15.0.0-0.2.fc42.s390x libgomp-15.0.0-0.2.fc42.s390x libidn2-2.3.7-2.fc41.s390x libmount-2.40.2-8.fc42.s390x libnghttp2-1.64.0-1.fc42.s390x libpkgconf-2.3.0-1.fc42.s390x libpsl-0.21.5-4.fc41.s390x libpwquality-1.4.5-11.fc41.s390x libselinux-3.8-0.rc3.1.fc42.s390x libsemanage-3.8-0.rc3.1.fc42.s390x libsepol-3.8-0.rc3.1.fc42.s390x libsmartcols-2.40.2-8.fc42.s390x libssh-0.11.1-1.fc42.s390x libssh-config-0.11.1-1.fc42.noarch libstdc++-15.0.0-0.2.fc42.s390x libtasn1-4.19.0-9.fc41.s390x libtirpc-1.3.6-1.fc42.s390x libtool-ltdl-2.5.4-1.fc42.s390x libunistring-1.1-8.fc41.s390x libuuid-2.40.2-8.fc42.s390x libverto-0.3.2-9.fc41.s390x libxcrypt-4.4.36-11.fc42.s390x libxml2-2.12.8-2.fc41.s390x libzstd-1.5.6-2.fc41.s390x lua-libs-5.4.7-1.fc42.s390x lua-srpm-macros-1-14.fc41.noarch lz4-libs-1.10.0-1.fc41.s390x mpfr-4.2.1-5.fc41.s390x ncurses-base-6.5-2.20240629.fc41.noarch ncurses-libs-6.5-2.20240629.fc41.s390x ocaml-srpm-macros-10-3.fc41.noarch openblas-srpm-macros-2-18.fc41.noarch openldap-2.6.8-6.fc42.s390x openssl-libs-3.2.2-8.fc42.s390x p11-kit-0.25.5-4.fc42.s390x p11-kit-trust-0.25.5-4.fc42.s390x package-notes-srpm-macros-0.5-12.fc41.noarch pam-1.7.0-3.fc42.s390x pam-libs-1.7.0-3.fc42.s390x patch-2.7.6-25.fc41.s390x pcre2-10.44-1.fc41.1.s390x pcre2-syntax-10.44-1.fc41.1.noarch perl-srpm-macros-1-56.fc41.noarch pkgconf-2.3.0-1.fc42.s390x pkgconf-m4-2.3.0-1.fc42.noarch pkgconf-pkg-config-2.3.0-1.fc42.s390x popt-1.19-7.fc41.s390x publicsuffix-list-dafsa-20240107-4.fc41.noarch pyproject-srpm-macros-1.16.3-1.fc42.noarch python-srpm-macros-3.13-3.fc41.noarch qt5-srpm-macros-5.15.15-1.fc42.noarch qt6-srpm-macros-6.8.1-4.fc42.noarch readline-8.2-11.fc42.s390x redhat-rpm-config-300-1.no_annobin.0.fc42.noarch rpm-4.20.0-1.fc42.s390x rpm-build-4.20.0-1.fc42.s390x rpm-build-libs-4.20.0-1.fc42.s390x rpm-libs-4.20.0-1.fc42.s390x rpm-sequoia-1.7.0-3.fc42.s390x rust-srpm-macros-26.3-3.fc42.noarch sed-4.9-3.fc41.s390x setup-2.15.0-5.fc41.noarch shadow-utils-4.17.0~rc1-1.fc42.s390x sqlite-libs-3.47.2-1.fc42.s390x systemd-libs-257-1.fc42.s390x tar-1.35-4.fc41.s390x unzip-6.0-65.fc42.s390x util-linux-2.40.2-8.fc42.s390x util-linux-core-2.40.2-8.fc42.s390x which-2.21-42.fc41.s390x xxhash-libs-0.8.2-4.fc42.s390x xz-5.6.3-2.fc42.s390x xz-libs-5.6.3-2.fc42.s390x zig-srpm-macros-1-3.fc41.noarch zip-3.0-42.fc42.s390x zlib-ng-compat-2.2.2-1.fc42.s390x zstd-1.5.6-2.fc41.s390x Start: buildsrpm Start: rpmbuild -bs Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1732665600 Wrote: /builddir/build/SRPMS/cinnamon-session-6.4.0-1.fc42.src.rpm Finish: rpmbuild -bs INFO: chroot_scan: 1 files copied to /var/lib/copr-rpmbuild/results/chroot_scan INFO: /var/lib/mock/fedora-rawhide-s390x-1734762221.542729/root/var/log/dnf5.log INFO: chroot_scan: creating tarball /var/lib/copr-rpmbuild/results/chroot_scan.tar.gz /bin/tar: Removing leading `/' from member names Finish: buildsrpm INFO: Done(/var/lib/copr-rpmbuild/workspace/workdir-rghfv1ro/cinnamon-session/cinnamon-session.spec) Config(child) 0 minutes 17 seconds INFO: Results and/or logs in: /var/lib/copr-rpmbuild/results INFO: Cleaning up build root ('cleanup_on_success=True') Start: clean chroot INFO: unmounting tmpfs. Finish: clean chroot INFO: Start(/var/lib/copr-rpmbuild/results/cinnamon-session-6.4.0-1.fc42.src.rpm) Config(fedora-rawhide-s390x) Start(bootstrap): chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-rawhide-s390x-bootstrap-1734762221.542729/root. INFO: reusing tmpfs at /var/lib/mock/fedora-rawhide-s390x-bootstrap-1734762221.542729/root. INFO: calling preinit hooks INFO: enabled root cache INFO: enabled package manager cache Start(bootstrap): cleaning package manager metadata Finish(bootstrap): cleaning package manager metadata Finish(bootstrap): chroot init Start: chroot init INFO: mounting tmpfs at /var/lib/mock/fedora-rawhide-s390x-1734762221.542729/root. INFO: calling preinit hooks INFO: enabled root cache Start: unpacking root cache Finish: unpacking root cache INFO: enabled package manager cache Start: cleaning package manager metadata Finish: cleaning package manager metadata INFO: enabled HW Info plugin INFO: Buildroot is handled by package management downloaded with a bootstrap image: rpm-4.20.0-1.fc42.s390x rpm-sequoia-1.7.0-3.fc42.s390x dnf5-5.2.8.1-2.fc42.s390x dnf5-plugins-5.2.8.1-2.fc42.s390x Finish: chroot init Start: build phase for cinnamon-session-6.4.0-1.fc42.src.rpm Start: build setup for cinnamon-session-6.4.0-1.fc42.src.rpm Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1732665600 Wrote: /builddir/build/SRPMS/cinnamon-session-6.4.0-1.fc42.src.rpm Updating and loading repositories: Additional repo https_fedorapeople_org 100% | 4.4 KiB/s | 1.5 KiB | 00m00s Copr repository 100% | 13.1 KiB/s | 1.5 KiB | 00m00s fedora 100% | 7.0 KiB/s | 2.5 KiB | 00m00s Repositories loaded. Package Arch Version Repository Size Installing: cinnamon-desktop-devel s390x 6.4.1-1.fc42 copr_base 497.0 KiB gcc s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 79.2 MiB glib2-devel s390x 2.83.0-3.fc42 fedora 15.8 MiB gtk3-devel s390x 3.24.43-2.fc41 fedora 33.9 MiB intltool noarch 0.51.0-27.fc41 fedora 169.1 KiB libICE-devel s390x 1.1.2-1.fc42 fedora 261.8 KiB libSM-devel s390x 1.2.5-1.fc42 fedora 18.8 KiB libX11-devel s390x 1.8.10-2.fc42 fedora 1.0 MiB libXau-devel s390x 1.0.12-1.fc42 fedora 7.5 KiB libXcomposite-devel s390x 0.4.6-4.fc41 fedora 8.0 KiB libXext-devel s390x 1.3.6-2.fc41 fedora 98.9 KiB libcanberra-devel s390x 0.30-36.fc41 fedora 145.0 KiB libglvnd-devel s390x 1:1.7.0-5.fc41 fedora 2.1 MiB meson noarch 1.6.1-1.fc42 fedora 11.4 MiB pango-devel s390x 1.54.0-2.fc41 fedora 1.5 MiB python3-packaging noarch 24.2-2.fc42 fedora 555.7 KiB systemd-devel s390x 257-1.fc42 fedora 610.4 KiB xapps-devel s390x 2.8.7-1.fc42 fedora 508.1 KiB xmlto s390x 0.0.29-1.fc41 fedora 120.0 KiB xorg-x11-xtrans-devel noarch 1.5.2-1.fc42 fedora 281.2 KiB Installing dependencies: abattis-cantarell-vf-fonts noarch 0.301-13.fc41 fedora 192.7 KiB adwaita-cursor-theme noarch 47.0-1.fc42 fedora 10.0 MiB adwaita-icon-theme noarch 47.0-1.fc42 fedora 1.2 MiB adwaita-icon-theme-legacy noarch 46.2-2.fc41 fedora 2.1 MiB alsa-lib s390x 1.2.13-3.fc42 fedora 1.5 MiB annobin-docs noarch 12.79-1.fc42 copr_base 98.6 KiB annobin-plugin-gcc s390x 12.79-1.fc42 copr_base 985.0 KiB at-spi2-atk s390x 2.54.0-1.fc42 fedora 302.9 KiB at-spi2-atk-devel s390x 2.54.0-1.fc42 fedora 1.6 KiB at-spi2-core s390x 2.54.0-1.fc42 fedora 1.5 MiB at-spi2-core-devel s390x 2.54.0-1.fc42 fedora 4.1 MiB atk s390x 2.54.0-1.fc42 fedora 272.6 KiB atk-devel s390x 2.54.0-1.fc42 fedora 5.9 MiB autoconf noarch 2.72-3.fc42 copr_base 2.8 MiB automake noarch 1.17-1.fc42 copr_base 1.8 MiB avahi-glib s390x 0.8-30.fc42 copr_base 14.2 KiB avahi-libs s390x 0.8-30.fc42 copr_base 161.4 KiB brotli s390x 1.1.0-5.fc42 copr_base 26.2 KiB brotli-devel s390x 1.1.0-5.fc42 copr_base 65.6 KiB bzip2-devel s390x 1.0.8-19.fc42 copr_base 309.8 KiB cairo s390x 1.18.2-2.fc42 copr_base 1.7 MiB cairo-devel s390x 1.18.2-2.fc42 copr_base 2.3 MiB cairo-gobject s390x 1.18.2-2.fc42 copr_base 33.9 KiB cairo-gobject-devel s390x 1.18.2-2.fc42 copr_base 7.0 KiB cinnamon-desktop s390x 6.4.1-1.fc42 copr_base 1.0 MiB cmake-filesystem s390x 3.31.2-1.fc42 fedora 0.0 B colord-libs s390x 1.4.7-5.fc41 fedora 873.6 KiB cpp s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 26.6 MiB cups-filesystem noarch 1:2.4.11-8.fc42 fedora 0.0 B cups-libs s390x 1:2.4.11-8.fc42 fedora 713.4 KiB dbus s390x 1:1.16.0-1.fc42 fedora 0.0 B dbus-broker s390x 36-4.fc41 fedora 393.8 KiB dbus-common noarch 1:1.16.0-1.fc42 fedora 11.2 KiB dbus-devel s390x 1:1.16.0-1.fc42 fedora 131.7 KiB dbus-libs s390x 1:1.16.0-1.fc42 fedora 355.4 KiB default-fonts-core-sans noarch 4.2-2.fc42 fedora 11.9 KiB desktop-backgrounds-gnome noarch 41.0.0-1.fc42 fedora 361.0 B desktop-file-utils s390x 0.27-2.fc41 fedora 253.7 KiB docbook-dtds noarch 1.0-87.fc41 fedora 8.3 MiB docbook-style-xsl noarch 1.79.2-23.fc41 fedora 15.6 MiB emacs-filesystem noarch 1:30.0-3.fc41 fedora 0.0 B expat s390x 2.6.4-1.fc42 fedora 308.9 KiB f41-backgrounds-base noarch 41.0.1-1.fc42 fedora 34.1 MiB f41-backgrounds-gnome noarch 41.0.1-1.fc42 fedora 706.0 B flac-libs s390x 1.4.3-5.fc41 fedora 625.4 KiB flex s390x 2.6.4-18.fc41 fedora 913.1 KiB fontconfig s390x 2.15.0-8.fc41 fedora 825.6 KiB fontconfig-devel s390x 2.15.0-8.fc41 fedora 117.2 KiB fonts-filesystem noarch 1:2.0.5-17.fc41 fedora 0.0 B fpaste noarch 0.5.0.0-1.fc41 fedora 75.7 KiB freetype s390x 2.13.3-1.fc42 fedora 934.9 KiB freetype-devel s390x 2.13.3-1.fc42 fedora 8.5 MiB fribidi s390x 1.0.16-1.fc42 fedora 206.0 KiB fribidi-devel s390x 1.0.16-1.fc42 fedora 78.0 KiB gcc-plugin-annobin s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 51.3 KiB gdk-pixbuf2 s390x 2.42.12-6.fc41 fedora 2.5 MiB gdk-pixbuf2-devel s390x 2.42.12-6.fc41 fedora 2.3 MiB gdk-pixbuf2-modules s390x 2.42.12-6.fc41 fedora 59.2 KiB gettext s390x 0.23-1.fc42 fedora 5.3 MiB gettext-common-devel noarch 0.23-1.fc42 fedora 589.0 KiB gettext-devel s390x 0.23-1.fc42 fedora 1.2 MiB gettext-envsubst s390x 0.23-1.fc42 fedora 69.2 KiB gettext-libs s390x 0.23-1.fc42 fedora 2.1 MiB gettext-runtime s390x 0.23-1.fc42 fedora 465.0 KiB glib2 s390x 2.83.0-3.fc42 fedora 14.9 MiB glibc-devel s390x 2.40.9000-24.fc42 fedora 2.6 MiB gnome-themes-extra s390x 3.28-20.fc41 fedora 47.6 KiB gnutls s390x 3.8.8-1.fc42 fedora 3.2 MiB gobject-introspection s390x 1.82.0-1.fc42 fedora 407.9 KiB google-noto-fonts-common noarch 20240901-1.fc42 fedora 17.5 KiB google-noto-sans-vf-fonts noarch 20240901-1.fc42 fedora 1.2 MiB graphite2 s390x 1.3.14-16.fc41 fedora 207.4 KiB graphite2-devel s390x 1.3.14-16.fc41 fedora 49.1 KiB groff-base s390x 1.23.0-7.fc41 fedora 4.3 MiB gsettings-desktop-schemas s390x 47.1-1.fc42 fedora 5.4 MiB gsm s390x 1.0.22-7.fc41 fedora 68.6 KiB gstreamer1 s390x 1.24.10-1.fc42 fedora 5.5 MiB gtk-update-icon-cache s390x 3.24.43-2.fc41 fedora 70.0 KiB gtk2 s390x 2.24.33-19.fc41 fedora 13.2 MiB gtk2-devel s390x 2.24.33-19.fc41 fedora 23.8 MiB gtk3 s390x 3.24.43-2.fc41 fedora 23.1 MiB harfbuzz s390x 10.1.0-2.fc42 fedora 2.7 MiB harfbuzz-cairo s390x 10.1.0-2.fc42 fedora 46.1 KiB harfbuzz-devel s390x 10.1.0-2.fc42 fedora 5.1 MiB harfbuzz-icu s390x 10.1.0-2.fc42 fedora 10.1 KiB hicolor-icon-theme noarch 0.17-19.fc41 fedora 72.2 KiB highcontrast-icon-theme noarch 3.28-20.fc41 fedora 4.2 MiB hwdata noarch 0.390-1.fc42 fedora 9.3 MiB iso-codes noarch 4.17.0-1.fc42 fedora 20.3 MiB jbigkit-libs s390x 2.1-30.fc41 fedora 121.2 KiB json-glib s390x 1.10.6-1.fc42 fedora 590.4 KiB kernel-headers s390x 6.13.0-0.rc3.29.fc42 fedora 6.5 MiB lame-libs s390x 3.100-18.fc41 fedora 1.2 MiB lcms2 s390x 2.16-4.fc41 fedora 456.7 KiB libICE s390x 1.1.2-1.fc42 fedora 199.8 KiB libSM s390x 1.2.5-1.fc42 fedora 103.4 KiB libX11 s390x 1.8.10-2.fc42 fedora 1.4 MiB libX11-common noarch 1.8.10-2.fc42 fedora 1.1 MiB libX11-xcb s390x 1.8.10-2.fc42 fedora 14.8 KiB libXau s390x 1.0.12-1.fc42 fedora 67.6 KiB libXcomposite s390x 0.4.6-4.fc41 fedora 44.3 KiB libXcursor s390x 1.2.3-1.fc42 fedora 53.5 KiB libXcursor-devel s390x 1.2.3-1.fc42 fedora 22.7 KiB libXdamage s390x 1.1.6-4.fc41 fedora 43.5 KiB libXdamage-devel s390x 1.1.6-4.fc41 fedora 2.5 KiB libXext s390x 1.3.6-2.fc41 fedora 97.7 KiB libXfixes s390x 6.0.1-4.fc41 fedora 30.1 KiB libXfixes-devel s390x 6.0.1-4.fc41 fedora 9.2 KiB libXft s390x 2.3.8-7.fc41 fedora 172.2 KiB libXft-devel s390x 2.3.8-7.fc41 fedora 31.7 KiB libXi s390x 1.8.2-1.fc42 fedora 84.4 KiB libXi-devel s390x 1.8.2-1.fc42 fedora 132.5 KiB libXinerama s390x 1.1.5-7.fc41 fedora 18.8 KiB libXinerama-devel s390x 1.1.5-7.fc41 fedora 7.0 KiB libXmu s390x 1.2.1-2.fc41 fedora 211.0 KiB libXrandr s390x 1.5.4-4.fc41 fedora 55.5 KiB libXrandr-devel s390x 1.5.4-4.fc41 fedora 21.8 KiB libXrender s390x 0.9.12-1.fc42 fedora 48.5 KiB libXrender-devel s390x 0.9.12-1.fc42 fedora 50.1 KiB libXt s390x 1.3.1-1.fc42 fedora 472.2 KiB libXtst s390x 1.2.5-1.fc41 fedora 41.3 KiB libXtst-devel s390x 1.2.5-1.fc41 fedora 11.6 KiB libXxf86vm s390x 1.1.6-1.fc42 fedora 24.0 KiB libasan s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 1.6 MiB libasyncns s390x 0.8-29.fc41 fedora 55.2 KiB libatomic s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 26.0 KiB libb2 s390x 0.98.1-12.fc41 fedora 42.0 KiB libblkid-devel s390x 2.40.2-8.fc42 fedora 44.9 KiB libcanberra s390x 0.30-36.fc41 fedora 281.3 KiB libcanberra-gtk2 s390x 0.30-36.fc41 fedora 49.8 KiB libcanberra-gtk3 s390x 0.30-36.fc41 fedora 70.2 KiB libcloudproviders s390x 0.3.5-5.fc41 fedora 132.0 KiB libcloudproviders-devel s390x 0.3.5-5.fc41 fedora 375.4 KiB libdatrie s390x 0.2.13-10.fc41 fedora 61.7 KiB libdatrie-devel s390x 0.2.13-10.fc41 fedora 587.1 KiB libdbusmenu s390x 16.04.0-28.fc41 fedora 544.1 KiB libdbusmenu-gtk3 s390x 16.04.0-28.fc41 fedora 92.5 KiB libdrm s390x 2.4.124-1.fc42 fedora 401.0 KiB libedit s390x 3.1-53.20240808cvs.fc41 fedora 280.0 KiB libepoxy s390x 1.5.10-8.fc41 fedora 1.3 MiB libepoxy-devel s390x 1.5.10-8.fc41 fedora 1.6 MiB libffi-devel s390x 3.4.6-3.fc42 fedora 29.4 KiB libglvnd s390x 1:1.7.0-5.fc41 fedora 903.5 KiB libglvnd-core-devel s390x 1:1.7.0-5.fc41 fedora 40.3 KiB libglvnd-egl s390x 1:1.7.0-5.fc41 fedora 76.6 KiB libglvnd-gles s390x 1:1.7.0-5.fc41 fedora 129.7 KiB libglvnd-glx s390x 1:1.7.0-5.fc41 fedora 793.4 KiB libglvnd-opengl s390x 1:1.7.0-5.fc41 fedora 217.1 KiB libgnomekbd s390x 3.28.1-6.fc41 fedora 623.7 KiB libgnomekbd-devel s390x 3.28.1-6.fc41 fedora 119.1 KiB libgusb s390x 0.4.9-2.fc41 fedora 161.8 KiB libicu s390x 76.1-1.fc42 fedora 36.6 MiB libicu-devel s390x 76.1-1.fc42 fedora 5.0 MiB libjpeg-turbo s390x 3.0.4-1.fc42 fedora 747.8 KiB libjpeg-turbo-devel s390x 3.0.4-1.fc42 fedora 353.1 KiB liblerc s390x 4.0.0-7.fc41 fedora 269.0 KiB liblerc-devel s390x 4.0.0-7.fc41 fedora 4.3 MiB libmount-devel s390x 2.40.2-8.fc42 fedora 63.5 KiB libmpc s390x 1.3.1-6.fc41 fedora 164.5 KiB libogg s390x 2:1.3.5-9.fc41 fedora 53.2 KiB libpciaccess s390x 0.16-13.fc41 fedora 44.4 KiB libpng s390x 2:1.6.44-1.fc42 fedora 257.6 KiB libpng-devel s390x 2:1.6.44-1.fc42 fedora 889.5 KiB libselinux-devel s390x 3.8-0.rc3.1.fc42 fedora 126.8 KiB libsepol-devel s390x 3.8-0.rc3.1.fc42 fedora 120.8 KiB libsndfile s390x 1.2.2-5.fc42 fedora 614.2 KiB libsoup3 s390x 3.6.1-1.fc42 fedora 1.2 MiB libtdb s390x 1.4.12-3.fc42 fedora 104.9 KiB libtextstyle s390x 0.23-1.fc42 fedora 206.4 KiB libthai s390x 0.1.29-9.fc41 fedora 787.3 KiB libthai-devel s390x 0.1.29-9.fc41 fedora 700.8 KiB libtiff s390x 4.7.0-2.fc42 fedora 658.4 KiB libtiff-devel s390x 4.7.0-2.fc42 fedora 761.9 KiB libtracker-sparql s390x 3.7.3-4.fc42 fedora 1.1 MiB libubsan s390x 15.0.0-0.2.fc42 https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch 480.5 KiB libunwind s390x 1.8.0-5.fc42 fedora 341.3 KiB libusb1 s390x 1.0.27-4.fc42 fedora 174.0 KiB libuuid-devel s390x 2.40.2-8.fc42 fedora 40.9 KiB libvorbis s390x 1:1.3.7-11.fc41 fedora 905.2 KiB libwayland-client s390x 1.23.0-2.fc41 fedora 73.9 KiB libwayland-cursor s390x 1.23.0-2.fc41 fedora 41.2 KiB libwayland-egl s390x 1.23.0-2.fc41 fedora 16.4 KiB libwayland-server s390x 1.23.0-2.fc41 fedora 98.4 KiB libwebp s390x 1.4.0-4.fc41 fedora 666.2 KiB libwebp-devel s390x 1.4.0-4.fc41 fedora 120.3 KiB libxcb s390x 1.17.0-3.fc42 fedora 1.2 MiB libxcb-devel s390x 1.17.0-3.fc42 fedora 2.7 MiB libxcrypt-devel s390x 4.4.36-11.fc42 fedora 30.5 KiB libxkbcommon s390x 1.7.0-4.fc41 fedora 360.0 KiB libxkbcommon-devel s390x 1.7.0-4.fc41 fedora 359.6 KiB libxkbfile s390x 1.1.3-2.fc41 fedora 221.7 KiB libxkbfile-devel s390x 1.1.3-2.fc41 fedora 36.8 KiB libxklavier s390x 5.4-26.fc41 fedora 157.9 KiB libxklavier-devel s390x 5.4-26.fc41 fedora 243.7 KiB libxml2-devel s390x 2.12.8-2.fc41 fedora 3.4 MiB libxshmfence s390x 1.3.2-5.fc42 fedora 12.5 KiB libxslt s390x 1.1.42-2.fc41 fedora 494.5 KiB libzstd-devel s390x 1.5.6-2.fc41 fedora 202.4 KiB llvm-libs s390x 19.1.5-1.fc42 fedora 187.3 MiB lm_sensors-libs s390x 3.6.0-20.fc41 fedora 85.6 KiB m4 s390x 1.4.19-10.fc41 fedora 628.5 KiB mailcap noarch 2.1.54-7.fc41 fedora 86.0 KiB make s390x 1:4.4.1-9.fc42 fedora 1.9 MiB mesa-dri-drivers s390x 24.3.1-1.fc42 fedora 15.9 MiB mesa-filesystem s390x 24.3.1-1.fc42 fedora 3.6 KiB mesa-libEGL s390x 24.3.1-1.fc42 fedora 379.5 KiB mesa-libGL s390x 24.3.1-1.fc42 fedora 542.8 KiB mesa-libgbm s390x 24.3.1-1.fc42 fedora 76.3 KiB mesa-libglapi s390x 24.3.1-1.fc42 fedora 346.2 KiB mpdecimal s390x 2.5.1-16.fc41 fedora 224.7 KiB mpg123-libs s390x 1.32.9-1.fc42 fedora 841.2 KiB ncurses s390x 6.5-2.20240629.fc41 fedora 641.5 KiB nettle s390x 3.10-3.fc41 fedora 849.2 KiB ninja-build s390x 1.12.1-3.fc41 fedora 439.5 KiB opus s390x 1.5.2-1.fc42 fedora 447.3 KiB pango s390x 1.54.0-2.fc41 fedora 1.0 MiB pcre2-devel s390x 10.44-1.fc41.1 fedora 2.0 MiB pcre2-utf16 s390x 10.44-1.fc41.1 fedora 625.6 KiB pcre2-utf32 s390x 10.44-1.fc41.1 fedora 593.5 KiB perl-AutoLoader noarch 5.74-512.fc42 fedora 20.5 KiB perl-B s390x 1.89-512.fc42 fedora 517.7 KiB perl-Carp noarch 1.54-511.fc41 fedora 46.6 KiB perl-Class-Struct noarch 0.68-512.fc42 fedora 25.4 KiB perl-Clone s390x 0.47-1.fc42 fedora 36.3 KiB perl-Compress-Raw-Bzip2 s390x 2.213-1.fc42 fedora 71.2 KiB perl-Compress-Raw-Zlib s390x 2.213-1.fc42 fedora 167.1 KiB perl-Data-Dump noarch 1.25-11.fc41 fedora 50.2 KiB perl-Data-Dumper s390x 2.189-512.fc41 fedora 115.5 KiB perl-Digest noarch 1.20-511.fc41 fedora 35.3 KiB perl-Digest-HMAC noarch 1.05-1.fc42 fedora 29.5 KiB perl-Digest-MD5 s390x 2.59-5.fc41 fedora 59.6 KiB perl-Digest-SHA s390x 1:6.04-512.fc41 fedora 116.4 KiB perl-DynaLoader s390x 1.56-512.fc42 fedora 32.1 KiB perl-Encode s390x 4:3.21-511.fc41 fedora 9.6 MiB perl-Encode-Locale noarch 1.05-30.fc41 fedora 19.0 KiB perl-Errno s390x 1.38-512.fc42 fedora 8.4 KiB perl-Exporter noarch 5.78-511.fc41 fedora 54.3 KiB perl-Fcntl s390x 1.18-512.fc42 fedora 56.8 KiB perl-File-Basename noarch 2.86-512.fc42 fedora 14.0 KiB perl-File-Compare noarch 1.100.800-512.fc42 fedora 5.6 KiB perl-File-Copy noarch 2.41-512.fc42 fedora 19.6 KiB perl-File-Find noarch 1.44-512.fc42 fedora 41.9 KiB perl-File-Listing noarch 6.16-4.fc41 fedora 41.2 KiB perl-File-Path noarch 2.18-511.fc41 fedora 63.5 KiB perl-File-Temp noarch 1:0.231.100-511.fc41 fedora 162.3 KiB perl-File-stat noarch 1.14-512.fc42 fedora 12.5 KiB perl-FileHandle noarch 2.05-512.fc42 fedora 9.3 KiB perl-Getopt-Long noarch 1:2.58-2.fc41 fedora 144.5 KiB perl-Getopt-Std noarch 1.14-512.fc42 fedora 11.2 KiB perl-HTML-Parser s390x 3.83-1.fc41 fedora 289.6 KiB perl-HTML-Tagset noarch 3.24-2.fc41 fedora 18.7 KiB perl-HTTP-Cookies noarch 6.11-4.fc41 fedora 73.4 KiB perl-HTTP-Date noarch 6.06-5.fc41 fedora 41.2 KiB perl-HTTP-Message noarch 7.00-1.fc42 fedora 215.3 KiB perl-HTTP-Negotiate noarch 6.01-39.fc41 fedora 27.6 KiB perl-HTTP-Tiny noarch 0.090-1.fc42 fedora 154.4 KiB perl-I18N-Langinfo s390x 0.24-512.fc42 fedora 42.5 KiB perl-IO s390x 1.55-512.fc42 fedora 150.9 KiB perl-IO-Compress noarch 2.213-2.fc42 fedora 1.0 MiB perl-IO-HTML noarch 1.004-13.fc41 fedora 45.2 KiB perl-IO-Socket-IP noarch 0.43-1.fc42 fedora 100.3 KiB perl-IO-Socket-SSL noarch 2.089-1.fc42 fedora 703.3 KiB perl-IPC-Open3 noarch 1.22-512.fc42 fedora 22.5 KiB perl-LWP-MediaTypes noarch 6.04-19.fc41 fedora 79.0 KiB perl-MIME-Base32 noarch 1.303-21.fc41 fedora 30.7 KiB perl-MIME-Base64 s390x 3.16-511.fc41 fedora 45.9 KiB perl-Module-Load noarch 1:0.36-511.fc41 fedora 14.9 KiB perl-NTLM noarch 1.09-39.fc41 fedora 31.2 KiB perl-Net-HTTP noarch 6.23-5.fc41 fedora 74.7 KiB perl-Net-SSLeay s390x 1.94-7.fc41 fedora 1.4 MiB perl-POSIX s390x 2.20-512.fc42 fedora 250.9 KiB perl-PathTools s390x 3.91-511.fc41 fedora 179.8 KiB perl-Pod-Escapes noarch 1:1.07-511.fc41 fedora 24.9 KiB perl-Pod-Perldoc noarch 3.28.01-512.fc41 fedora 163.7 KiB perl-Pod-Simple noarch 1:3.45-511.fc41 fedora 560.9 KiB perl-Pod-Usage noarch 4:2.03-511.fc41 fedora 84.8 KiB perl-Scalar-List-Utils s390x 5:1.68-1.fc42 fedora 152.6 KiB perl-SelectSaver noarch 1.02-512.fc42 fedora 2.2 KiB perl-Socket s390x 4:2.038-511.fc41 fedora 127.8 KiB perl-Storable s390x 1:3.32-511.fc41 fedora 232.2 KiB perl-Symbol noarch 1.09-512.fc42 fedora 6.8 KiB perl-Term-ANSIColor noarch 5.01-512.fc41 fedora 97.5 KiB perl-Term-Cap noarch 1.18-511.fc41 fedora 29.3 KiB perl-Text-ParseWords noarch 3.31-511.fc41 fedora 13.6 KiB perl-Text-Tabs+Wrap noarch 2024.001-511.fc41 fedora 22.6 KiB perl-Thread-Queue noarch 3.14-511.fc41 fedora 28.9 KiB perl-Time-Local noarch 2:1.350-511.fc41 fedora 69.0 KiB perl-TimeDate noarch 1:2.33-15.fc41 fedora 95.2 KiB perl-Try-Tiny noarch 0.32-1.fc42 fedora 67.3 KiB perl-URI noarch 5.31-1.fc42 fedora 257.0 KiB perl-WWW-RobotRules noarch 6.02-40.fc41 fedora 24.3 KiB perl-XML-Parser s390x 2.47-5.fc41 fedora 661.1 KiB perl-base noarch 2.27-512.fc42 fedora 12.5 KiB perl-constant noarch 1.33-512.fc41 fedora 26.2 KiB perl-if noarch 0.61.000-512.fc42 fedora 5.8 KiB perl-interpreter s390x 4:5.40.0-512.fc42 fedora 122.1 KiB perl-libnet noarch 3.15-512.fc41 fedora 289.4 KiB perl-libs s390x 4:5.40.0-512.fc42 fedora 10.2 MiB perl-libwww-perl noarch 6.77-2.fc41 fedora 521.0 KiB perl-locale noarch 1.12-512.fc42 fedora 6.5 KiB perl-mro s390x 1.29-512.fc42 fedora 45.4 KiB perl-overload noarch 1.37-512.fc42 fedora 71.5 KiB perl-overloading noarch 0.02-512.fc42 fedora 4.8 KiB perl-parent noarch 1:0.244-1.fc42 fedora 10.3 KiB perl-podlators noarch 1:6.0.2-2.fc41 fedora 317.5 KiB perl-subs noarch 1.04-512.fc42 fedora 2.1 KiB perl-threads s390x 1:2.40-511.fc41 fedora 114.9 KiB perl-threads-shared s390x 1.69-511.fc41 fedora 83.5 KiB perl-vars noarch 1.05-512.fc42 fedora 3.9 KiB pixman s390x 0.44.2-1.fc42 fedora 524.2 KiB pixman-devel s390x 0.44.2-1.fc42 fedora 49.4 KiB pulseaudio-libs s390x 17.0-2.fc41 fedora 3.4 MiB pulseaudio-libs-devel s390x 17.0-2.fc41 fedora 4.9 MiB pulseaudio-libs-glib2 s390x 17.0-2.fc41 fedora 19.6 KiB python-pip-wheel noarch 24.3.1-1.fc42 fedora 1.2 MiB python3 s390x 3.13.1-2.fc42 fedora 22.4 KiB python3-gobject-base s390x 3.50.0-2.fc42 fedora 1.5 MiB python3-libs s390x 3.13.1-2.fc42 fedora 40.0 MiB python3-setuptools noarch 74.1.3-4.fc42 fedora 8.4 MiB python3-xapps-overrides s390x 2.8.7-1.fc42 fedora 2.0 KiB redhat-menus noarch 12.0.2-28.fc41 fedora 672.4 KiB setxkbmap s390x 1.3.4-4.fc41 fedora 35.1 KiB sgml-common noarch 0.6.3-65.fc41 fedora 168.1 KiB shared-mime-info s390x 2.3-6.fc41 fedora 5.2 MiB sound-theme-freedesktop noarch 0.8-22.fc41 fedora 460.4 KiB sysprof-capture-devel s390x 47.2-1.fc42 fedora 255.3 KiB systemd-rpm-macros noarch 257-1.fc42 fedora 10.7 KiB tzdata noarch 2024b-1.fc42 fedora 1.6 MiB vim-filesystem noarch 2:9.1.919-1.fc42 fedora 40.0 B wayland-devel s390x 1.23.0-2.fc41 fedora 678.8 KiB xapps s390x 2.8.7-1.fc42 fedora 6.1 MiB xdg-utils noarch 1.2.1-2.fc41 fedora 346.3 KiB xhost s390x 1.0.9-8.fc41 fedora 25.3 KiB xkeyboard-config noarch 2.43-1.fc42 fedora 6.6 MiB xml-common noarch 0.6.3-65.fc41 fedora 78.4 KiB xmodmap s390x 1.0.11-7.fc41 fedora 55.1 KiB xorg-x11-proto-devel noarch 2024.1-3.fc41 fedora 1.7 MiB xorg-x11-xauth s390x 1:1.1.3-2.fc41 fedora 63.9 KiB xorg-x11-xinit s390x 1.4.2-3.fc41 fedora 136.2 KiB xprop s390x 1.2.7-2.fc41 fedora 62.6 KiB xrdb s390x 1.2.2-4.fc41 fedora 46.5 KiB xz-devel s390x 1:5.6.3-2.fc42 fedora 255.6 KiB zlib-ng-compat-devel s390x 2.2.2-1.fc42 fedora 106.8 KiB Transaction Summary: Installing: 363 packages Total size of inbound packages is 243 MiB. Need to download 64 MiB. After this operation, 862 MiB extra will be used (install 862 MiB, remove 0 B). [1/1] intltool-0:0.51.0-27.fc41.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [1/1] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/2] meson-0:1.6.1-1.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [2/2] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/3] glib2-devel-0:2.83.0-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [3/3] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/4] libglvnd-devel-1:1.7.0-5.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [4/4] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/5] gtk3-devel-0:3.24.43-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded -------------------------------------------------------------------------------- [5/5] Total 100% | 0.0 B/s | 0.0 B | 00m00s [1/8] systemd-devel-0:257-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [2/9] pango-devel-0:1.54.0-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 3/11] libX11-devel-0:1.8.10-2.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 4/13] libXau-devel-0:1.0.12-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 5/14] libXcomposite-devel-0:0.4.6-4.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 6/15] libXext-devel-0:1.3.6-2.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 7/17] python3-packaging-0:24.2-2.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 8/19] gcc-0:15.0.0-0.2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 9/21] gettext-devel-0:0.23-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [10/22] perl-Encode-4:3.21-511.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [11/23] perl-File-Basename-0:2.86-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [12/24] perl-File-Copy-0:2.41-512.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [13/25] perl-File-Find-0:1.44-512.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [14/26] perl-Getopt-Long-1:2.58-2.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [15/27] perl-PathTools-0:3.91-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [16/28] perl-Text-Tabs+Wrap-0:2024.001- 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [17/29] perl-XML-Parser-0:2.47-5.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [18/30] perl-interpreter-4:5.40.0-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [19/31] perl-libs-4:5.40.0-512.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [20/32] ninja-build-0:1.12.1-3.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [21/33] python3-0:3.13.1-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [22/34] python3-setuptools-0:74.1.3-4.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [23/35] glib2-0:2.83.0-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [24/36] libffi-devel-0:3.4.6-3.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [25/37] libmount-devel-0:2.40.2-8.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [26/38] libselinux-devel-0:3.8-0.rc3.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [27/39] pcre2-devel-0:10.44-1.fc41.1.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [28/40] sysprof-capture-devel-0:47.2-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [29/41] zlib-ng-compat-devel-0:2.2.2-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [30/42] libglvnd-1:1.7.0-5.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [31/43] libglvnd-core-devel-1:1.7.0-5.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [32/44] libglvnd-egl-1:1.7.0-5.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [33/45] libglvnd-gles-1:1.7.0-5.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [34/46] libglvnd-glx-1:1.7.0-5.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [35/47] libglvnd-opengl-1:1.7.0-5.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [36/48] at-spi2-atk-devel-0:2.54.0-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [37/49] atk-0:2.54.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [38/50] atk-devel-0:2.54.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [39/51] fontconfig-devel-0:2.15.0-8.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [40/52] fribidi-devel-0:1.0.16-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [41/53] gdk-pixbuf2-0:2.42.12-6.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [42/54] gdk-pixbuf2-devel-0:2.42.12-6.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [43/55] gtk3-0:3.24.43-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [44/56] harfbuzz-0:10.1.0-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [45/57] libXcursor-devel-0:1.2.3-1.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [46/58] libXdamage-devel-0:1.1.6-4.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [47/59] libXfixes-devel-0:6.0.1-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [48/60] libXi-devel-0:1.8.2-1.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [49/61] libXinerama-devel-0:1.1.5-7.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [50/62] libXrandr-devel-0:1.5.4-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [51/63] libcloudproviders-devel-0:0.3.5 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [52/64] libepoxy-0:1.5.10-8.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [53/65] libepoxy-devel-0:1.5.10-8.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [54/66] libxkbcommon-devel-0:1.7.0-4.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [55/67] pango-0:1.54.0-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [56/68] wayland-devel-0:1.23.0-2.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [57/70] xorg-x11-proto-devel-0:2024.1-3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [58/75] freetype-devel-0:2.13.3-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [59/76] harfbuzz-devel-0:10.1.0-2.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [60/77] libXft-devel-0:2.3.8-7.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [61/78] libXrender-devel-0:0.9.12-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [62/79] libthai-devel-0:0.1.29-9.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [63/82] libX11-0:1.8.10-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [64/83] libX11-xcb-0:1.8.10-2.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [65/84] libxcb-devel-0:1.17.0-3.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [66/88] libXau-0:1.0.12-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [67/89] libXcomposite-0:0.4.6-4.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [68/90] libXext-0:1.3.6-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [69/95] cpp-0:15.0.0-0.2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [70/96] glibc-devel-0:2.40.9000-24.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [71/97] libmpc-0:1.3.1-6.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [72/98] make-1:4.4.1-9.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 73/100] gettext-0:0.23-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 74/101] gettext-common-devel-0:0.23-1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 75/102] gettext-libs-0:0.23-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 76/103] perl-Carp-0:1.54-511.fc41.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 77/104] perl-Exporter-0:5.78-511.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 78/105] perl-Getopt-Std-0:1.14-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 79/106] perl-MIME-Base64-0:3.16-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 80/107] perl-Storable-1:3.32-511.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 81/108] perl-constant-0:1.33-512.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 82/109] perl-overload-0:1.37-512.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 83/110] perl-parent-1:0.244-1.fc42.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 84/111] perl-vars-0:1.05-512.fc42.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 85/112] perl-Pod-Usage-4:2.03-511.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 86/113] perl-Text-ParseWords-0:3.31-5 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 87/114] perl-base-0:2.27-512.fc42.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 88/115] perl-Errno-0:1.38-512.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 89/116] perl-Scalar-List-Utils-5:1.68 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 90/117] expat-0:2.6.4-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 91/118] perl-IO-0:1.55-512.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 92/119] perl-URI-0:5.31-1.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 93/120] perl-libwww-perl-0:6.77-2.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 94/121] perl-DynaLoader-0:1.56-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 95/122] emacs-filesystem-1:30.0-3.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 96/123] vim-filesystem-2:9.1.919-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 97/124] python3-libs-0:3.13.1-2.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 98/125] gnutls-0:3.8.8-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [ 99/126] libblkid-devel-0:2.40.2-8.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [100/127] libsepol-devel-0:3.8-0.rc3.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [101/128] pcre2-utf16-0:10.44-1.fc41.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [102/129] pcre2-utf32-0:10.44-1.fc41.1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [103/130] cmake-filesystem-0:3.31.2-1.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [104/131] mesa-libEGL-0:24.3.1-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [105/132] mesa-libGL-0:24.3.1-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [106/133] at-spi2-atk-0:2.54.0-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [107/134] at-spi2-core-devel-0:2.54.0-1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [108/135] dbus-devel-1:1.16.0-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [109/136] at-spi2-core-0:2.54.0-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [110/137] fontconfig-0:2.15.0-8.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [111/138] libxml2-devel-0:2.12.8-2.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [112/139] fribidi-0:1.0.16-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [113/140] libjpeg-turbo-0:3.0.4-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [114/141] libpng-2:1.6.44-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [115/142] shared-mime-info-0:2.3-6.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [116/143] libjpeg-turbo-devel-0:3.0.4-1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [117/144] libpng-devel-2:1.6.44-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [118/145] libtiff-devel-0:4.7.0-2.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [119/146] adwaita-icon-theme-0:47.0-1.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [120/147] colord-libs-0:1.4.7-5.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [121/148] cups-libs-1:2.4.11-8.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [122/149] gdk-pixbuf2-modules-0:2.42.12 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [123/150] gtk-update-icon-cache-0:3.24. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [124/151] hicolor-icon-theme-0:0.17-19. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [125/152] libXcursor-0:1.2.3-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [126/153] libXdamage-0:1.1.6-4.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [127/154] libXfixes-0:6.0.1-4.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [128/155] libXi-0:1.8.2-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [129/156] libXinerama-0:1.1.5-7.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [130/157] libXrandr-0:1.5.4-4.fc41.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [131/158] libcloudproviders-0:0.3.5-5.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [132/159] libtracker-sparql-0:3.7.3-4.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [133/160] libwayland-client-0:1.23.0-2. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [134/161] libwayland-cursor-0:1.23.0-2. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [135/162] libwayland-egl-0:1.23.0-2.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [136/163] libxkbcommon-0:1.7.0-4.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [137/164] freetype-0:2.13.3-1.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [138/165] graphite2-0:1.3.14-16.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [139/166] libXft-0:2.3.8-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [140/167] libXrender-0:0.9.12-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [141/168] libthai-0:0.1.29-9.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [142/169] libwayland-server-0:1.23.0-2. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [143/177] graphite2-devel-0:1.3.14-16.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [144/178] harfbuzz-cairo-0:10.1.0-2.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [145/179] harfbuzz-icu-0:10.1.0-2.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [146/180] libicu-devel-0:76.1-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [147/181] libdatrie-devel-0:0.2.13-10.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [148/182] libX11-common-0:1.8.10-2.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [149/183] libxcb-0:1.17.0-3.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [150/193] xml-common-0:0.6.3-65.fc41.no 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [151/194] m4-0:1.4.19-10.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [152/195] kernel-headers-0:6.13.0-0.rc3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [153/196] libxcrypt-devel-0:4.4.36-11.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [154/198] gettext-runtime-0:0.23-1.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [155/199] libtextstyle-0:0.23-1.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [156/200] perl-Fcntl-0:1.18-512.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [157/201] perl-mro-0:1.29-512.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [158/202] perl-overloading-0:0.02-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [159/203] perl-Pod-Perldoc-0:3.28.01-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [160/204] perl-podlators-1:6.0.2-2.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [161/205] perl-File-stat-0:1.14-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [162/206] perl-SelectSaver-0:1.02-512.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [163/207] perl-Socket-4:2.038-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [164/208] perl-Symbol-0:1.09-512.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [165/209] perl-Data-Dumper-0:2.189-512. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [166/210] perl-MIME-Base32-0:1.303-21.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [167/211] perl-libnet-0:3.15-512.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [168/212] perl-Data-Dump-0:1.25-11.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [169/213] perl-Digest-MD5-0:2.59-5.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [170/214] perl-Encode-Locale-0:1.05-30. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [171/215] perl-File-Listing-0:6.16-4.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [172/216] perl-HTML-Parser-0:3.83-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [173/217] perl-HTTP-Cookies-0:6.11-4.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [174/218] perl-HTTP-Date-0:6.06-5.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [175/219] perl-HTTP-Message-0:7.00-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [176/220] perl-HTTP-Negotiate-0:6.01-39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [177/221] perl-LWP-MediaTypes-0:6.04-19 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [178/222] perl-Module-Load-1:0.36-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [179/223] perl-NTLM-0:1.09-39.fc41.noar 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [180/224] perl-Net-HTTP-0:6.23-5.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [181/225] perl-Try-Tiny-0:0.32-1.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [182/226] perl-WWW-RobotRules-0:6.02-40 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [183/227] libb2-0:0.98.1-12.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [184/228] mpdecimal-0:2.5.1-16.fc41.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [185/229] python-pip-wheel-0:24.3.1-1.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [186/230] tzdata-0:2024b-1.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [187/231] nettle-0:3.10-3.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [188/232] libdrm-0:2.4.124-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [189/233] mesa-dri-drivers-0:24.3.1-1.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [190/234] mesa-libgbm-0:24.3.1-1.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [191/235] mesa-libglapi-0:24.3.1-1.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [192/236] libXxf86vm-0:1.1.6-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [193/237] dbus-libs-1:1.16.0-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [194/238] libXtst-devel-0:1.2.5-1.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [195/239] dbus-1:1.16.0-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [196/240] libXtst-0:1.2.5-1.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [197/241] xprop-0:1.2.7-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [198/242] default-fonts-core-sans-0:4.2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [199/243] fonts-filesystem-1:2.0.5-17.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [200/244] xz-devel-1:5.6.3-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [201/245] liblerc-devel-0:4.0.0-7.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [202/246] libtiff-0:4.7.0-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [203/247] libwebp-devel-0:1.4.0-4.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [204/248] libzstd-devel-0:1.5.6-2.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [205/249] adwaita-cursor-theme-0:47.0-1 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [206/250] adwaita-icon-theme-legacy-0:4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [207/251] lcms2-0:2.16-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [208/252] libgusb-0:0.4.9-2.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [209/253] cups-filesystem-1:2.4.11-8.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [210/254] json-glib-0:1.10.6-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [211/255] libicu-0:76.1-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [212/256] libsoup3-0:3.6.1-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [213/257] xkeyboard-config-0:2.43-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [214/258] libdatrie-0:0.2.13-10.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [215/266] desktop-file-utils-0:0.27-2.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [216/272] gettext-envsubst-0:0.23-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [217/273] groff-base-0:1.23.0-7.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [218/274] perl-File-Temp-1:0.231.100-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [219/275] perl-HTTP-Tiny-0:0.090-1.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [220/276] perl-IPC-Open3-0:1.22-512.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [221/277] perl-Pod-Simple-1:3.45-511.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [222/278] perl-POSIX-0:2.20-512.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [223/279] perl-Term-ANSIColor-0:5.01-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [224/280] perl-Term-Cap-0:1.18-511.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [225/281] perl-Class-Struct-0:0.68-512. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [226/282] perl-B-0:1.89-512.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [227/283] perl-FileHandle-0:2.05-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [228/284] perl-IO-Socket-IP-0:0.43-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [229/285] perl-Time-Local-2:1.350-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [230/286] perl-subs-0:1.04-512.fc42.noa 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [231/287] perl-Digest-0:1.20-511.fc41.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [232/288] perl-I18N-Langinfo-0:0.24-512 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [233/289] perl-HTML-Tagset-0:3.24-2.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [234/290] perl-locale-0:1.12-512.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [235/291] perl-TimeDate-1:2.33-15.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [236/292] perl-Clone-0:0.47-1.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [237/293] perl-Compress-Raw-Zlib-0:2.21 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [238/294] perl-IO-Compress-0:2.213-2.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [239/295] perl-IO-HTML-0:1.004-13.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [240/296] mailcap-0:2.1.54-7.fc41.noarc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [241/297] perl-Digest-HMAC-0:1.05-1.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [242/298] perl-IO-Socket-SSL-0:2.089-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [243/299] libpciaccess-0:0.16-13.fc41.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [244/300] libxshmfence-0:1.3.2-5.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [245/301] llvm-libs-0:19.1.5-1.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [246/302] lm_sensors-libs-0:3.6.0-20.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [247/303] mesa-filesystem-0:24.3.1-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [248/304] dbus-broker-0:36-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [249/305] abattis-cantarell-vf-fonts-0: 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [250/306] google-noto-sans-vf-fonts-0:2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [251/307] liblerc-0:4.0.0-7.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [252/308] jbigkit-libs-0:2.1-30.fc41.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [253/309] libwebp-0:1.4.0-4.fc41.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [254/310] libusb1-0:1.0.27-4.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [255/317] gobject-introspection-0:1.82. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [256/319] perl-File-Path-0:2.18-511.fc4 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [257/320] perl-Net-SSLeay-0:1.94-7.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [258/321] perl-Pod-Escapes-1:1.07-511.f 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [259/322] perl-if-0:0.61.000-512.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [260/323] ncurses-0:6.5-2.20240629.fc41 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [261/324] perl-AutoLoader-0:5.74-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [262/325] perl-Compress-Raw-Bzip2-0:2.2 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [263/326] perl-Digest-SHA-1:6.04-512.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [264/327] hwdata-0:0.390-1.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [265/328] libedit-0:3.1-53.20240808cvs. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [266/329] dbus-common-1:1.16.0-1.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [267/330] google-noto-fonts-common-0:20 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [268/332] cairo-devel-0:1.18.2-2.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [269/333] pixman-devel-0:0.44.2-1.fc42. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [270/334] pixman-0:0.44.2-1.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [271/335] cairo-0:1.18.2-2.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [272/336] cairo-gobject-0:1.18.2-2.fc42 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [273/337] avahi-glib-0:0.8-30.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [274/338] avahi-libs-0:0.8-30.fc42.s390 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [275/339] automake-0:1.17-1.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [276/340] perl-Thread-Queue-0:3.14-511. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [277/341] perl-threads-1:2.40-511.fc41. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [278/342] perl-threads-shared-0:1.69-51 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [279/343] cairo-gobject-devel-0:1.18.2- 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [280/344] brotli-devel-0:1.1.0-5.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [281/345] brotli-0:1.1.0-5.fc42.s390x 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [282/346] bzip2-devel-0:1.0.8-19.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [283/355] autoconf-0:2.72-3.fc42.noarch 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [284/356] perl-File-Compare-0:1.100.800 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [285/357] libasan-0:15.0.0-0.2.fc42.s39 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [286/358] libatomic-0:15.0.0-0.2.fc42.s 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [287/359] libubsan-0:15.0.0-0.2.fc42.s3 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [288/360] gcc-plugin-annobin-0:15.0.0-0 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [289/361] systemd-rpm-macros-0:257-1.fc 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [290/362] annobin-plugin-gcc-0:12.79-1. 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [291/363] annobin-docs-0:12.79-1.fc42.n 100% | 0.0 B/s | 0.0 B | 00m00s >>> Already downloaded [292/363] libcanberra-devel-0:0.30-36.f 100% | 225.3 KiB/s | 30.6 KiB | 00m00s [293/363] libSM-devel-0:1.2.5-1.fc42.s3 100% | 76.5 KiB/s | 11.9 KiB | 00m00s [294/363] libICE-devel-0:1.1.2-1.fc42.s 100% | 254.7 KiB/s | 45.8 KiB | 00m00s [295/363] xapps-devel-0:2.8.7-1.fc42.s3 100% | 857.5 KiB/s | 48.9 KiB | 00m00s [296/363] xmlto-0:0.0.29-1.fc41.s390x 100% | 1.2 MiB/s | 54.9 KiB | 00m00s [297/363] libICE-0:1.1.2-1.fc42.s390x 100% | 1.2 MiB/s | 77.6 KiB | 00m00s [298/363] gtk2-devel-0:2.24.33-19.fc41. 100% | 13.8 MiB/s | 2.8 MiB | 00m00s [299/363] libcanberra-0:0.30-36.fc41.s3 100% | 1.4 MiB/s | 85.0 KiB | 00m00s [300/363] libcanberra-gtk2-0:0.30-36.fc 100% | 790.5 KiB/s | 24.5 KiB | 00m00s [301/363] libcanberra-gtk3-0:0.30-36.fc 100% | 1.0 MiB/s | 31.0 KiB | 00m00s [302/363] libSM-0:1.2.5-1.fc42.s390x 100% | 1.4 MiB/s | 44.3 KiB | 00m00s [303/363] libuuid-devel-0:2.40.2-8.fc42 100% | 1.1 MiB/s | 34.1 KiB | 00m00s [304/363] libgnomekbd-devel-0:3.28.1-6. 100% | 535.0 KiB/s | 20.3 KiB | 00m00s [305/363] libxkbfile-devel-0:1.1.3-2.fc 100% | 411.7 KiB/s | 15.6 KiB | 00m00s [306/363] cinnamon-desktop-devel-0:6.4. 100% | 91.6 KiB/s | 51.3 KiB | 00m01s [307/363] xorg-x11-xtrans-devel-0:1.5.2 100% | 118.5 KiB/s | 72.3 KiB | 00m01s [308/363] docbook-dtds-0:1.0-87.fc41.no 100% | 5.2 MiB/s | 334.7 KiB | 00m00s [309/363] docbook-style-xsl-0:1.79.2-23 100% | 20.4 MiB/s | 1.5 MiB | 00m00s [310/363] flex-0:2.6.4-18.fc41.s390x 100% | 4.5 MiB/s | 319.0 KiB | 00m00s [311/363] xapps-0:2.8.7-1.fc42.s390x 100% | 37.1 MiB/s | 5.3 MiB | 00m00s [312/363] libxslt-0:1.1.42-2.fc41.s390x 100% | 3.0 MiB/s | 189.8 KiB | 00m00s [313/363] pulseaudio-libs-devel-0:17.0- 100% | 7.3 MiB/s | 466.3 KiB | 00m00s [314/363] alsa-lib-0:1.2.13-3.fc42.s390 100% | 6.8 MiB/s | 539.5 KiB | 00m00s [315/363] gtk2-0:2.24.33-19.fc41.s390x 100% | 35.3 MiB/s | 3.3 MiB | 00m00s [316/363] libtdb-0:1.4.12-3.fc42.s390x 100% | 1.7 MiB/s | 53.4 KiB | 00m00s [317/363] gstreamer1-0:1.24.10-1.fc42.s 100% | 21.1 MiB/s | 1.6 MiB | 00m00s [318/363] libvorbis-1:1.3.7-11.fc41.s39 100% | 3.4 MiB/s | 211.9 KiB | 00m00s [319/363] pulseaudio-libs-0:17.0-2.fc41 100% | 11.1 MiB/s | 715.5 KiB | 00m00s [320/363] sound-theme-freedesktop-0:0.8 100% | 6.1 MiB/s | 382.5 KiB | 00m00s [321/363] libxklavier-devel-0:5.4-26.fc 100% | 1.0 MiB/s | 40.1 KiB | 00m00s [322/363] libgnomekbd-0:3.28.1-6.fc41.s 100% | 2.5 MiB/s | 173.8 KiB | 00m00s [323/363] libxkbfile-0:1.1.3-2.fc41.s39 100% | 1.6 MiB/s | 97.3 KiB | 00m00s [324/363] fpaste-0:0.5.0.0-1.fc41.noarc 100% | 891.4 KiB/s | 33.9 KiB | 00m00s [325/363] libdbusmenu-gtk3-0:16.04.0-28 100% | 943.5 KiB/s | 36.8 KiB | 00m00s [326/363] python3-xapps-overrides-0:2.8 100% | 265.8 KiB/s | 10.4 KiB | 00m00s [327/363] xorg-x11-xinit-0:1.4.2-3.fc41 100% | 1.5 MiB/s | 57.5 KiB | 00m00s [328/363] sgml-common-0:0.6.3-65.fc41.n 100% | 1.9 MiB/s | 60.7 KiB | 00m00s [329/363] pulseaudio-libs-glib2-0:17.0- 100% | 518.3 KiB/s | 15.5 KiB | 00m00s [330/363] xdg-utils-0:1.2.1-2.fc41.noar 100% | 955.1 KiB/s | 79.3 KiB | 00m00s [331/363] libunwind-0:1.8.0-5.fc42.s390 100% | 2.0 MiB/s | 61.7 KiB | 00m00s [332/363] libogg-2:1.3.5-9.fc41.s390x 100% | 1.1 MiB/s | 34.0 KiB | 00m00s [333/363] libasyncns-0:0.8-29.fc41.s390 100% | 986.5 KiB/s | 29.6 KiB | 00m00s [334/363] libxklavier-0:5.4-26.fc41.s39 100% | 1.7 MiB/s | 63.2 KiB | 00m00s [335/363] libsndfile-0:1.2.2-5.fc42.s39 100% | 3.9 MiB/s | 240.6 KiB | 00m00s [336/363] libdbusmenu-0:16.04.0-28.fc41 100% | 1.9 MiB/s | 130.9 KiB | 00m00s [337/363] setxkbmap-0:1.3.4-4.fc41.s390 100% | 590.6 KiB/s | 22.4 KiB | 00m00s [338/363] python3-gobject-base-0:3.50.0 100% | 6.3 MiB/s | 394.7 KiB | 00m00s [339/363] xhost-0:1.0.9-8.fc41.s390x 100% | 559.4 KiB/s | 20.7 KiB | 00m00s [340/363] xmodmap-0:1.0.11-7.fc41.s390x 100% | 848.3 KiB/s | 32.2 KiB | 00m00s [341/363] xorg-x11-xauth-1:1.1.3-2.fc41 100% | 1.1 MiB/s | 35.2 KiB | 00m00s [342/363] xrdb-0:1.2.2-4.fc41.s390x 100% | 801.2 KiB/s | 29.6 KiB | 00m00s [343/363] gsm-0:1.0.22-7.fc41.s390x 100% | 1.3 MiB/s | 39.6 KiB | 00m00s [344/363] flac-libs-0:1.4.3-5.fc41.s390 100% | 3.6 MiB/s | 226.4 KiB | 00m00s [345/363] lame-libs-0:3.100-18.fc41.s39 100% | 5.6 MiB/s | 351.9 KiB | 00m00s [346/363] mpg123-libs-0:1.32.9-1.fc42.s 100% | 5.3 MiB/s | 338.2 KiB | 00m00s [347/363] opus-0:1.5.2-1.fc42.s390x 100% | 4.1 MiB/s | 258.1 KiB | 00m00s [348/363] iso-codes-0:4.17.0-1.fc42.noa 100% | 38.4 MiB/s | 3.6 MiB | 00m00s [349/363] libXmu-0:1.2.1-2.fc41.s390x 100% | 1.0 MiB/s | 82.9 KiB | 00m00s [350/363] libXt-0:1.3.1-1.fc42.s390x 100% | 2.3 MiB/s | 190.4 KiB | 00m00s [351/363] desktop-backgrounds-gnome-0:4 100% | 236.6 KiB/s | 9.0 KiB | 00m00s [352/363] gnome-themes-extra-0:3.28-20. 100% | 679.6 KiB/s | 25.8 KiB | 00m00s [353/363] f41-backgrounds-gnome-0:41.0. 100% | 193.6 KiB/s | 7.6 KiB | 00m00s [354/363] redhat-menus-0:12.0.2-28.fc41 100% | 1.8 MiB/s | 155.4 KiB | 00m00s [355/363] gsettings-desktop-schemas-0:4 100% | 12.1 MiB/s | 782.9 KiB | 00m00s [356/363] highcontrast-icon-theme-0:3.2 100% | 39.7 MiB/s | 3.2 MiB | 00m00s [357/363] f41-backgrounds-base-0:41.0.1 100% | 81.9 MiB/s | 34.1 MiB | 00m00s [358/363] cinnamon-desktop-0:6.4.1-1.fc 100% | 457.1 KiB/s | 277.0 KiB | 00m01s -------------------------------------------------------------------------------- [363/363] Total 100% | 0.0 B/s | 0.0 B | 00m00s Running transaction [ 1/365] Verify package files 100% | 444.0 B/s | 363.0 B | 00m01s [ 2/365] Prepare transaction 100% | 1.7 KiB/s | 363.0 B | 00m00s [ 3/365] Installing xorg-x11-proto-dev 100% | 222.8 MiB/s | 1.8 MiB | 00m00s [ 4/365] Installing expat-0:2.6.4-1.fc 100% | 303.7 MiB/s | 311.0 KiB | 00m00s [ 5/365] Installing dbus-libs-1:1.16.0 100% | 58.0 MiB/s | 356.5 KiB | 00m00s [ 6/365] Installing xml-common-0:0.6.3 100% | 79.2 MiB/s | 81.1 KiB | 00m00s [ 7/365] Installing cmake-filesystem-0 100% | 7.4 MiB/s | 7.6 KiB | 00m00s [ 8/365] Installing zlib-ng-compat-dev 100% | 105.8 MiB/s | 108.3 KiB | 00m00s [ 9/365] Installing libglvnd-1:1.7.0-5 100% | 294.6 MiB/s | 904.9 KiB | 00m00s [ 10/365] Installing libwayland-client- 100% | 73.3 MiB/s | 75.1 KiB | 00m00s [ 11/365] Installing libpng-2:1.6.44-1. 100% | 126.4 MiB/s | 258.8 KiB | 00m00s [ 12/365] Installing libpng-devel-2:1.6 100% | 290.8 MiB/s | 893.4 KiB | 00m00s [ 13/365] Installing avahi-libs-0:0.8-3 100% | 160.2 MiB/s | 164.0 KiB | 00m00s [ 14/365] Installing libogg-2:1.3.5-9.f 100% | 0.0 B/s | 54.8 KiB | 00m00s [ 15/365] Installing libvorbis-1:1.3.7- 100% | 295.5 MiB/s | 907.7 KiB | 00m00s [ 16/365] Installing libicu-0:76.1-1.fc 100% | 288.5 MiB/s | 36.6 MiB | 00m00s [ 17/365] Installing fonts-filesystem-1 100% | 0.0 B/s | 788.0 B | 00m00s [ 18/365] Installing libtdb-0:1.4.12-3. 100% | 103.2 MiB/s | 105.7 KiB | 00m00s [ 19/365] Installing libwayland-server- 100% | 97.3 MiB/s | 99.6 KiB | 00m00s [ 20/365] Installing libjpeg-turbo-0:3. 100% | 244.0 MiB/s | 749.5 KiB | 00m00s [ 21/365] Installing fribidi-0:1.0.16-1 100% | 203.7 MiB/s | 208.6 KiB | 00m00s [ 22/365] Installing emacs-filesystem-1 100% | 0.0 B/s | 544.0 B | 00m00s [ 23/365] Installing libXau-0:1.0.12-1. 100% | 67.5 MiB/s | 69.1 KiB | 00m00s [ 24/365] Installing libxcb-0:1.17.0-3. 100% | 249.1 MiB/s | 1.2 MiB | 00m00s [ 25/365] Installing libX11-xcb-0:1.8.1 100% | 0.0 B/s | 15.7 KiB | 00m00s [ 26/365] Installing libICE-0:1.1.2-1.f 100% | 196.5 MiB/s | 201.2 KiB | 00m00s [ 27/365] Installing libepoxy-0:1.5.10- 100% | 329.1 MiB/s | 1.3 MiB | 00m00s [ 28/365] Installing libSM-0:1.2.5-1.fc 100% | 102.3 MiB/s | 104.8 KiB | 00m00s [ 29/365] Installing fribidi-devel-0:1. 100% | 80.0 MiB/s | 81.9 KiB | 00m00s [ 30/365] Installing libjpeg-turbo-deve 100% | 347.3 MiB/s | 355.6 KiB | 00m00s [ 31/365] Installing libwayland-cursor- 100% | 0.0 B/s | 42.3 KiB | 00m00s [ 32/365] Installing pixman-0:0.44.2-1. 100% | 256.5 MiB/s | 525.3 KiB | 00m00s [ 33/365] Installing pixman-devel-0:0.4 100% | 0.0 B/s | 50.2 KiB | 00m00s [ 34/365] Installing libwebp-0:1.4.0-4. 100% | 218.2 MiB/s | 670.3 KiB | 00m00s [ 35/365] Installing liblerc-0:4.0.0-7. 100% | 264.2 MiB/s | 270.6 KiB | 00m00s [ 36/365] Installing libdatrie-0:0.2.13 100% | 0.0 B/s | 62.8 KiB | 00m00s [ 37/365] Installing libthai-0:0.1.29-9 100% | 256.9 MiB/s | 789.1 KiB | 00m00s [ 38/365] Installing libtextstyle-0:0.2 100% | 202.4 MiB/s | 207.2 KiB | 00m00s [ 39/365] Installing gettext-libs-0:0.2 100% | 234.8 MiB/s | 2.1 MiB | 00m00s [ 40/365] Installing m4-0:1.4.19-10.fc4 100% | 124.0 MiB/s | 634.8 KiB | 00m00s [ 41/365] Installing graphite2-0:1.3.14 100% | 102.3 MiB/s | 209.6 KiB | 00m00s [ 42/365] Installing libwayland-egl-0:1 100% | 17.1 MiB/s | 17.5 KiB | 00m00s [ 43/365] Installing hicolor-icon-theme 100% | 10.3 MiB/s | 179.5 KiB | 00m00s [ 44/365] Installing libmpc-0:1.3.1-6.f 100% | 162.1 MiB/s | 166.0 KiB | 00m00s [ 45/365] Installing libffi-devel-0:3.4 100% | 30.0 MiB/s | 30.8 KiB | 00m00s [ 46/365] Installing wayland-devel-0:1. 100% | 167.8 MiB/s | 687.3 KiB | 00m00s [ 47/365] Installing cpp-0:15.0.0-0.2.f 100% | 253.7 MiB/s | 26.6 MiB | 00m00s [ 48/365] Installing graphite2-devel-0: 100% | 0.0 B/s | 50.6 KiB | 00m00s [ 49/365] Installing flex-0:2.6.4-18.fc 100% | 224.4 MiB/s | 919.2 KiB | 00m00s [ 50/365] Installing libdatrie-devel-0: 100% | 195.1 MiB/s | 599.2 KiB | 00m00s [ 51/365] Installing libthai-devel-0:0. 100% | 233.7 MiB/s | 717.8 KiB | 00m00s [ 52/365] Installing liblerc-devel-0:4. 100% | 428.7 MiB/s | 4.3 MiB | 00m00s [ 53/365] Installing libwebp-devel-0:1. 100% | 121.1 MiB/s | 124.0 KiB | 00m00s [ 54/365] Installing libICE-devel-0:1.1 100% | 257.2 MiB/s | 263.4 KiB | 00m00s [ 55/365] Installing libXau-devel-0:1.0 100% | 1.3 MiB/s | 9.4 KiB | 00m00s [ 56/365] Installing libxcb-devel-0:1.1 100% | 63.9 MiB/s | 3.1 MiB | 00m00s [ 57/365] Installing abattis-cantarell- 100% | 94.9 MiB/s | 194.4 KiB | 00m00s [ 58/365] Installing libicu-devel-0:76. 100% | 253.5 MiB/s | 5.1 MiB | 00m00s [ 59/365] Installing flac-libs-0:1.4.3- 100% | 204.5 MiB/s | 628.1 KiB | 00m00s [ 60/365] Installing libglvnd-opengl-1: 100% | 71.0 MiB/s | 218.0 KiB | 00m00s [ 61/365] Installing iso-codes-0:4.17.0 100% | 259.2 MiB/s | 20.5 MiB | 00m00s [ 62/365] Installing annobin-docs-0:12. 100% | 0.0 B/s | 99.7 KiB | 00m00s [ 63/365] Installing libubsan-0:15.0.0- 100% | 235.0 MiB/s | 481.4 KiB | 00m00s [ 64/365] Installing libatomic-0:15.0.0 100% | 0.0 B/s | 26.9 KiB | 00m00s [ 65/365] Installing libasan-0:15.0.0-0 100% | 318.2 MiB/s | 1.6 MiB | 00m00s [ 66/365] Installing f41-backgrounds-ba 100% | 793.6 MiB/s | 34.1 MiB | 00m00s [ 67/365] Installing f41-backgrounds-gn 100% | 124.1 KiB/s | 1.1 KiB | 00m00s [ 68/365] Installing highcontrast-icon- 100% | 69.2 MiB/s | 4.8 MiB | 00m00s [ 69/365] Installing redhat-menus-0:12. 100% | 134.7 MiB/s | 689.6 KiB | 00m00s [ 70/365] Installing bzip2-devel-0:1.0. 100% | 303.5 MiB/s | 310.7 KiB | 00m00s [ 71/365] Installing brotli-0:1.1.0-5.f 100% | 0.0 B/s | 26.9 KiB | 00m00s [ 72/365] Installing brotli-devel-0:1.1 100% | 0.0 B/s | 68.0 KiB | 00m00s [ 73/365] Installing google-noto-fonts- 100% | 0.0 B/s | 18.3 KiB | 00m00s [ 74/365] Installing google-noto-sans-v 100% | 249.8 MiB/s | 1.2 MiB | 00m00s [ 75/365] Installing default-fonts-core 100% | 17.8 MiB/s | 18.2 KiB | 00m00s [ 76/365] Installing dbus-common-1:1.16 100% | 645.3 KiB/s | 13.6 KiB | 00m00s [ 77/365] Installing dbus-broker-0:36-4 100% | 43.0 MiB/s | 396.3 KiB | 00m00s [ 78/365] Installing dbus-1:1.16.0-1.fc 100% | 0.0 B/s | 124.0 B | 00m00s [ 79/365] Installing libedit-0:3.1-53.2 100% | 137.5 MiB/s | 281.6 KiB | 00m00s [ 80/365] Installing llvm-libs-0:19.1.5 100% | 362.9 MiB/s | 187.3 MiB | 00m01s [ 81/365] Installing hwdata-0:0.390-1.f 100% | 467.0 MiB/s | 9.3 MiB | 00m00s [ 82/365] Installing libpciaccess-0:0.1 100% | 0.0 B/s | 45.8 KiB | 00m00s [ 83/365] Installing libdrm-0:2.4.124-1 100% | 197.7 MiB/s | 404.8 KiB | 00m00s [ 84/365] Installing ncurses-0:6.5-2.20 100% | 211.0 MiB/s | 648.1 KiB | 00m00s [ 85/365] Installing opus-0:1.5.2-1.fc4 100% | 219.0 MiB/s | 448.4 KiB | 00m00s [ 86/365] Installing mpg123-libs-0:1.32 100% | 206.0 MiB/s | 843.8 KiB | 00m00s [ 87/365] Installing lame-libs-0:3.100- 100% | 303.4 MiB/s | 1.2 MiB | 00m00s [ 88/365] Installing gsm-0:1.0.22-7.fc4 100% | 68.6 MiB/s | 70.2 KiB | 00m00s [ 89/365] Installing libsndfile-0:1.2.2 100% | 300.7 MiB/s | 615.8 KiB | 00m00s [ 90/365] Installing libusb1-0:1.0.27-4 100% | 171.5 MiB/s | 175.7 KiB | 00m00s [ 91/365] Installing jbigkit-libs-0:2.1 100% | 120.3 MiB/s | 123.2 KiB | 00m00s [ 92/365] Installing libtiff-0:4.7.0-2. 100% | 215.1 MiB/s | 660.7 KiB | 00m00s [ 93/365] Installing mesa-filesystem-0: 100% | 0.0 B/s | 4.3 KiB | 00m00s [ 94/365] Installing lm_sensors-libs-0: 100% | 0.0 B/s | 86.8 KiB | 00m00s [ 95/365] Installing libxshmfence-0:1.3 100% | 0.0 B/s | 13.6 KiB | 00m00s [ 96/365] Installing mesa-libgbm-0:24.3 100% | 75.7 MiB/s | 77.6 KiB | 00m00s [ 97/365] Installing mesa-libglapi-0:24 100% | 338.8 MiB/s | 347.0 KiB | 00m00s [ 98/365] Installing mesa-dri-drivers-0 100% | 368.9 MiB/s | 15.9 MiB | 00m00s [ 99/365] Installing mesa-libEGL-0:24.3 100% | 185.8 MiB/s | 380.5 KiB | 00m00s [100/365] Installing libglvnd-egl-1:1.7 100% | 76.4 MiB/s | 78.2 KiB | 00m00s [101/365] Installing libglvnd-gles-1:1. 100% | 128.1 MiB/s | 131.1 KiB | 00m00s [102/365] Installing mailcap-0:2.1.54-7 100% | 12.1 MiB/s | 87.1 KiB | 00m00s [103/365] Installing groff-base-0:1.23. 100% | 180.6 MiB/s | 4.3 MiB | 00m00s [104/365] Installing perl-Digest-0:1.20 100% | 36.2 MiB/s | 37.1 KiB | 00m00s [105/365] Installing perl-FileHandle-0: 100% | 0.0 B/s | 9.8 KiB | 00m00s [106/365] Installing perl-Digest-MD5-0: 100% | 60.0 MiB/s | 61.5 KiB | 00m00s [107/365] Installing perl-B-0:1.89-512. 100% | 254.5 MiB/s | 521.1 KiB | 00m00s [108/365] Installing perl-MIME-Base32-0 100% | 0.0 B/s | 32.2 KiB | 00m00s [109/365] Installing perl-libnet-0:3.15 100% | 143.9 MiB/s | 294.7 KiB | 00m00s [110/365] Installing perl-Data-Dumper-0 100% | 114.6 MiB/s | 117.4 KiB | 00m00s [111/365] Installing perl-IO-Socket-IP- 100% | 99.8 MiB/s | 102.2 KiB | 00m00s [112/365] Installing perl-AutoLoader-0: 100% | 0.0 B/s | 20.9 KiB | 00m00s [113/365] Installing perl-URI-0:5.31-1. 100% | 87.8 MiB/s | 269.6 KiB | 00m00s [114/365] Installing perl-Text-Tabs+Wra 100% | 0.0 B/s | 23.9 KiB | 00m00s [115/365] Installing perl-Time-Local-2: 100% | 0.0 B/s | 70.6 KiB | 00m00s [116/365] Installing perl-locale-0:1.12 100% | 0.0 B/s | 6.9 KiB | 00m00s [117/365] Installing perl-File-Path-0:2 100% | 0.0 B/s | 64.5 KiB | 00m00s [118/365] Installing perl-Pod-Escapes-1 100% | 0.0 B/s | 25.9 KiB | 00m00s [119/365] Installing perl-if-0:0.61.000 100% | 0.0 B/s | 6.2 KiB | 00m00s [120/365] Installing perl-Net-SSLeay-0: 100% | 237.5 MiB/s | 1.4 MiB | 00m00s [121/365] Installing perl-IO-Socket-SSL 100% | 230.3 MiB/s | 707.4 KiB | 00m00s [122/365] Installing perl-Term-ANSIColo 100% | 96.9 MiB/s | 99.2 KiB | 00m00s [123/365] Installing perl-Term-Cap-0:1. 100% | 0.0 B/s | 30.6 KiB | 00m00s [124/365] Installing perl-Class-Struct- 100% | 0.0 B/s | 25.9 KiB | 00m00s [125/365] Installing perl-IPC-Open3-0:1 100% | 0.0 B/s | 23.3 KiB | 00m00s [126/365] Installing perl-POSIX-0:2.20- 100% | 246.3 MiB/s | 252.2 KiB | 00m00s [127/365] Installing perl-File-Temp-1:0 100% | 160.2 MiB/s | 164.1 KiB | 00m00s [128/365] Installing perl-HTTP-Tiny-0:0 100% | 152.8 MiB/s | 156.4 KiB | 00m00s [129/365] Installing perl-Pod-Simple-1: 100% | 278.5 MiB/s | 570.5 KiB | 00m00s [130/365] Installing perl-Socket-4:2.03 100% | 126.8 MiB/s | 129.9 KiB | 00m00s [131/365] Installing perl-SelectSaver-0 100% | 0.0 B/s | 2.6 KiB | 00m00s [132/365] Installing perl-Symbol-0:1.09 100% | 0.0 B/s | 7.2 KiB | 00m00s [133/365] Installing perl-File-stat-0:1 100% | 0.0 B/s | 13.1 KiB | 00m00s [134/365] Installing perl-Pod-Perldoc-0 100% | 165.3 MiB/s | 169.3 KiB | 00m00s [135/365] Installing perl-podlators-1:6 100% | 313.9 MiB/s | 321.4 KiB | 00m00s [136/365] Installing perl-Text-ParseWor 100% | 0.0 B/s | 14.6 KiB | 00m00s [137/365] Installing perl-base-0:2.27-5 100% | 0.0 B/s | 12.9 KiB | 00m00s [138/365] Installing perl-Fcntl-0:1.18- 100% | 0.0 B/s | 57.9 KiB | 00m00s [139/365] Installing perl-mro-0:1.29-51 100% | 0.0 B/s | 46.5 KiB | 00m00s [140/365] Installing perl-overloading-0 100% | 0.0 B/s | 5.5 KiB | 00m00s [141/365] Installing perl-IO-0:1.55-512 100% | 151.5 MiB/s | 155.1 KiB | 00m00s [142/365] Installing perl-Pod-Usage-4:2 100% | 84.3 MiB/s | 86.3 KiB | 00m00s [143/365] Installing perl-File-Basename 100% | 0.0 B/s | 14.6 KiB | 00m00s [144/365] Installing perl-Getopt-Std-0: 100% | 0.0 B/s | 11.7 KiB | 00m00s [145/365] Installing perl-MIME-Base64-0 100% | 47.0 MiB/s | 48.1 KiB | 00m00s [146/365] Installing perl-constant-0:1. 100% | 0.0 B/s | 27.4 KiB | 00m00s [147/365] Installing perl-parent-1:0.24 100% | 0.0 B/s | 11.0 KiB | 00m00s [148/365] Installing perl-vars-0:1.05-5 100% | 0.0 B/s | 4.3 KiB | 00m00s [149/365] Installing perl-Errno-0:1.38- 100% | 0.0 B/s | 8.8 KiB | 00m00s [150/365] Installing perl-Scalar-List-U 100% | 152.7 MiB/s | 156.4 KiB | 00m00s [151/365] Installing perl-overload-0:1. 100% | 0.0 B/s | 71.9 KiB | 00m00s [152/365] Installing perl-Storable-1:3. 100% | 228.3 MiB/s | 233.8 KiB | 00m00s [153/365] Installing perl-Getopt-Long-1 100% | 143.8 MiB/s | 147.2 KiB | 00m00s [154/365] Installing perl-Carp-0:1.54-5 100% | 0.0 B/s | 47.7 KiB | 00m00s [155/365] Installing perl-Exporter-0:5. 100% | 0.0 B/s | 55.6 KiB | 00m00s [156/365] Installing perl-PathTools-0:3 100% | 180.0 MiB/s | 184.3 KiB | 00m00s [157/365] Installing perl-DynaLoader-0: 100% | 0.0 B/s | 32.5 KiB | 00m00s [158/365] Installing perl-Encode-4:3.21 100% | 331.4 MiB/s | 9.6 MiB | 00m00s [159/365] Installing perl-libs-4:5.40.0 100% | 245.4 MiB/s | 10.3 MiB | 00m00s [160/365] Installing perl-interpreter-4 100% | 120.9 MiB/s | 123.8 KiB | 00m00s [161/365] Installing perl-File-Copy-0:2 100% | 0.0 B/s | 20.2 KiB | 00m00s [162/365] Installing perl-Compress-Raw- 100% | 165.4 MiB/s | 169.4 KiB | 00m00s [163/365] Installing perl-File-Find-0:1 100% | 0.0 B/s | 42.5 KiB | 00m00s [164/365] Installing perl-LWP-MediaType 100% | 0.0 B/s | 80.5 KiB | 00m00s [165/365] Installing perl-threads-1:2.4 100% | 114.2 MiB/s | 117.0 KiB | 00m00s [166/365] Installing perl-threads-share 100% | 83.7 MiB/s | 85.7 KiB | 00m00s [167/365] Installing perl-Thread-Queue- 100% | 0.0 B/s | 30.4 KiB | 00m00s [168/365] Installing perl-Digest-SHA-1: 100% | 116.1 MiB/s | 118.9 KiB | 00m00s [169/365] Installing perl-Digest-HMAC-0 100% | 0.0 B/s | 31.5 KiB | 00m00s [170/365] Installing perl-NTLM-0:1.09-3 100% | 0.0 B/s | 32.7 KiB | 00m00s [171/365] Installing perl-Module-Load-1 100% | 0.0 B/s | 15.9 KiB | 00m00s [172/365] Installing perl-Try-Tiny-0:0. 100% | 69.4 MiB/s | 71.1 KiB | 00m00s [173/365] Installing perl-WWW-RobotRule 100% | 0.0 B/s | 25.8 KiB | 00m00s [174/365] Installing perl-subs-0:1.04-5 100% | 0.0 B/s | 2.5 KiB | 00m00s [175/365] Installing perl-Data-Dump-0:1 100% | 0.0 B/s | 52.2 KiB | 00m00s [176/365] Installing perl-I18N-Langinfo 100% | 0.0 B/s | 44.0 KiB | 00m00s [177/365] Installing perl-Encode-Locale 100% | 0.0 B/s | 20.1 KiB | 00m00s [178/365] Installing perl-HTML-Tagset-0 100% | 4.8 MiB/s | 19.7 KiB | 00m00s [179/365] Installing perl-TimeDate-1:2. 100% | 101.2 MiB/s | 103.7 KiB | 00m00s [180/365] Installing perl-HTTP-Date-0:6 100% | 0.0 B/s | 42.6 KiB | 00m00s [181/365] Installing perl-File-Listing- 100% | 0.0 B/s | 42.5 KiB | 00m00s [182/365] Installing perl-Clone-0:0.47- 100% | 0.0 B/s | 38.0 KiB | 00m00s [183/365] Installing perl-IO-HTML-0:1.0 100% | 0.0 B/s | 46.8 KiB | 00m00s [184/365] Installing perl-Compress-Raw- 100% | 71.8 MiB/s | 73.5 KiB | 00m00s [185/365] Installing perl-IO-Compress-0 100% | 257.8 MiB/s | 1.0 MiB | 00m00s [186/365] Installing perl-HTTP-Message- 100% | 214.7 MiB/s | 219.9 KiB | 00m00s [187/365] Installing perl-HTML-Parser-0 100% | 144.3 MiB/s | 295.6 KiB | 00m00s [188/365] Installing perl-HTTP-Cookies- 100% | 73.9 MiB/s | 75.7 KiB | 00m00s [189/365] Installing perl-HTTP-Negotiat 100% | 0.0 B/s | 28.7 KiB | 00m00s [190/365] Installing perl-Net-HTTP-0:6. 100% | 75.4 MiB/s | 77.2 KiB | 00m00s [191/365] Installing perl-libwww-perl-0 100% | 172.6 MiB/s | 530.3 KiB | 00m00s [192/365] Installing perl-XML-Parser-0: 100% | 218.6 MiB/s | 671.5 KiB | 00m00s [193/365] Installing perl-File-Compare- 100% | 6.0 MiB/s | 6.1 KiB | 00m00s [194/365] Installing autoconf-0:2.72-3. 100% | 350.1 MiB/s | 2.8 MiB | 00m00s [195/365] Installing automake-0:1.17-1. 100% | 258.9 MiB/s | 1.8 MiB | 00m00s [196/365] Installing gettext-envsubst-0 100% | 69.0 MiB/s | 70.6 KiB | 00m00s [197/365] Installing gettext-runtime-0: 100% | 115.8 MiB/s | 474.4 KiB | 00m00s [198/365] Installing gettext-0:0.23-1.f 100% | 331.6 MiB/s | 5.3 MiB | 00m00s [199/365] Installing libasyncns-0:0.8-2 100% | 55.1 MiB/s | 56.4 KiB | 00m00s [200/365] Installing pulseaudio-libs-0: 100% | 288.0 MiB/s | 3.5 MiB | 00m00s [201/365] Installing libunwind-0:1.8.0- 100% | 167.7 MiB/s | 343.4 KiB | 00m00s [202/365] Installing xkeyboard-config-0 100% | 302.0 MiB/s | 6.6 MiB | 00m00s [203/365] Installing libxkbcommon-0:1.7 100% | 176.6 MiB/s | 361.8 KiB | 00m00s [204/365] Installing cups-filesystem-1: 100% | 0.0 B/s | 1.8 KiB | 00m00s [205/365] Installing lcms2-0:2.16-4.fc4 100% | 74.6 MiB/s | 458.4 KiB | 00m00s [206/365] Installing adwaita-icon-theme 100% | 69.5 MiB/s | 2.4 MiB | 00m00s [207/365] Installing adwaita-cursor-the 100% | 627.3 MiB/s | 10.0 MiB | 00m00s [208/365] Installing adwaita-icon-theme 100% | 82.7 MiB/s | 1.3 MiB | 00m00s [209/365] Installing gnome-themes-extra 100% | 0.0 B/s | 49.4 KiB | 00m00s [210/365] Installing libzstd-devel-0:1. 100% | 198.5 MiB/s | 203.2 KiB | 00m00s [211/365] Installing libtiff-devel-0:4. 100% | 251.5 MiB/s | 772.7 KiB | 00m00s [212/365] Installing xz-devel-1:5.6.3-2 100% | 126.7 MiB/s | 259.4 KiB | 00m00s [213/365] Installing libxml2-devel-0:2. 100% | 341.6 MiB/s | 3.4 MiB | 00m00s [214/365] Installing libxkbcommon-devel 100% | 352.9 MiB/s | 361.3 KiB | 00m00s [215/365] Installing nettle-0:3.10-3.fc 100% | 277.4 MiB/s | 852.3 KiB | 00m00s [216/365] Installing gnutls-0:3.8.8-1.f 100% | 289.0 MiB/s | 3.2 MiB | 00m00s [217/365] Installing glib2-0:2.83.0-3.f 100% | 331.3 MiB/s | 14.9 MiB | 00m00s [218/365] Installing freetype-0:2.13.3- 100% | 228.7 MiB/s | 936.6 KiB | 00m00s [219/365] Installing harfbuzz-0:10.1.0- 100% | 270.7 MiB/s | 2.7 MiB | 00m00s [220/365] Installing fontconfig-0:2.15. 100% | 821.0 KiB/s | 844.8 KiB | 00m01s [221/365] Installing shared-mime-info-0 100% | 142.0 MiB/s | 2.6 MiB | 00m00s [222/365] Installing gdk-pixbuf2-0:2.42 100% | 211.4 MiB/s | 2.5 MiB | 00m00s [223/365] Installing gdk-pixbuf2-module 100% | 0.0 B/s | 60.4 KiB | 00m00s [224/365] Installing gtk-update-icon-ca 100% | 0.0 B/s | 71.2 KiB | 00m00s [225/365] Installing libcloudproviders- 100% | 130.7 MiB/s | 133.9 KiB | 00m00s [226/365] Installing pulseaudio-libs-gl 100% | 0.0 B/s | 20.4 KiB | 00m00s [227/365] Installing json-glib-0:1.10.6 100% | 147.0 MiB/s | 602.2 KiB | 00m00s [228/365] Installing cups-libs-1:2.4.11 100% | 232.7 MiB/s | 715.0 KiB | 00m00s [229/365] Installing libgusb-0:0.4.9-2. 100% | 159.6 MiB/s | 163.5 KiB | 00m00s [230/365] Installing colord-libs-0:1.4. 100% | 285.3 MiB/s | 876.5 KiB | 00m00s [231/365] Installing libcloudproviders- 100% | 186.8 MiB/s | 382.5 KiB | 00m00s [232/365] Installing harfbuzz-icu-0:10. 100% | 0.0 B/s | 10.9 KiB | 00m00s [233/365] Installing libsoup3-0:3.6.1-1 100% | 171.7 MiB/s | 1.2 MiB | 00m00s [234/365] Installing libdbusmenu-0:16.0 100% | 266.7 MiB/s | 546.3 KiB | 00m00s [235/365] Installing desktop-file-utils 100% | 251.4 MiB/s | 257.4 KiB | 00m00s [236/365] Installing xdg-utils-0:1.2.1- 100% | 341.3 MiB/s | 349.5 KiB | 00m00s [237/365] Installing gobject-introspect 100% | 201.3 MiB/s | 412.2 KiB | 00m00s [238/365] Installing avahi-glib-0:0.8-3 100% | 0.0 B/s | 15.0 KiB | 00m00s [239/365] Installing libtracker-sparql- 100% | 219.2 MiB/s | 1.1 MiB | 00m00s [240/365] Installing gsettings-desktop- 100% | 336.9 MiB/s | 5.4 MiB | 00m00s [241/365] Installing desktop-background 100% | 171.9 KiB/s | 880.0 B | 00m00s [242/365] Installing tzdata-0:2024b-1.f 100% | 58.9 MiB/s | 1.9 MiB | 00m00s [243/365] Installing python-pip-wheel-0 100% | 622.1 MiB/s | 1.2 MiB | 00m00s [244/365] Installing mpdecimal-0:2.5.1- 100% | 220.5 MiB/s | 225.8 KiB | 00m00s [245/365] Installing libb2-0:0.98.1-12. 100% | 7.0 MiB/s | 43.1 KiB | 00m00s [246/365] Installing python3-libs-0:3.1 100% | 294.9 MiB/s | 40.4 MiB | 00m00s [247/365] Installing python3-0:3.13.1-2 100% | 23.6 MiB/s | 24.2 KiB | 00m00s [248/365] Installing python3-packaging- 100% | 110.9 MiB/s | 568.0 KiB | 00m00s [249/365] Installing python3-setuptools 100% | 225.2 MiB/s | 8.6 MiB | 00m00s [250/365] Installing gstreamer1-0:1.24. 100% | 262.0 MiB/s | 5.5 MiB | 00m00s [251/365] Installing fpaste-0:0.5.0.0-1 100% | 75.1 MiB/s | 76.9 KiB | 00m00s [252/365] Installing python3-gobject-ba 100% | 171.9 MiB/s | 1.5 MiB | 00m00s [253/365] Installing kernel-headers-0:6 100% | 189.3 MiB/s | 6.6 MiB | 00m00s [254/365] Installing libxcrypt-devel-0: 100% | 10.7 MiB/s | 32.9 KiB | 00m00s [255/365] Installing glibc-devel-0:2.40 100% | 176.4 MiB/s | 2.6 MiB | 00m00s [256/365] Installing sgml-common-0:0.6. 100% | 85.4 MiB/s | 174.9 KiB | 00m00s [257/365] Installing docbook-dtds-0:1.0 100% | 41.2 MiB/s | 8.3 MiB | 00m00s [258/365] Installing docbook-style-xsl- 100% | 233.3 MiB/s | 15.9 MiB | 00m00s [259/365] Installing libX11-common-0:1. 100% | 131.9 MiB/s | 1.2 MiB | 00m00s [260/365] Installing libX11-0:1.8.10-2. 100% | 196.8 MiB/s | 1.4 MiB | 00m00s [261/365] Installing libX11-devel-0:1.8 100% | 70.0 MiB/s | 1.1 MiB | 00m00s [262/365] Installing libXext-0:1.3.6-2. 100% | 96.6 MiB/s | 99.0 KiB | 00m00s [263/365] Installing libXext-devel-0:1. 100% | 54.2 MiB/s | 110.9 KiB | 00m00s [264/365] Installing libXrender-0:0.9.1 100% | 0.0 B/s | 49.8 KiB | 00m00s [265/365] Installing cairo-0:1.18.2-2.f 100% | 249.8 MiB/s | 1.7 MiB | 00m00s [266/365] Installing libXrender-devel-0 100% | 0.0 B/s | 51.0 KiB | 00m00s [267/365] Installing libXi-0:1.8.2-1.fc 100% | 0.0 B/s | 85.4 KiB | 00m00s [268/365] Installing cairo-gobject-0:1. 100% | 0.0 B/s | 34.8 KiB | 00m00s [269/365] Installing libXfixes-0:6.0.1- 100% | 0.0 B/s | 31.5 KiB | 00m00s [270/365] Installing libXfixes-devel-0: 100% | 0.0 B/s | 9.9 KiB | 00m00s [271/365] Installing libXi-devel-0:1.8. 100% | 70.6 MiB/s | 144.6 KiB | 00m00s [272/365] Installing libXrandr-0:1.5.4- 100% | 0.0 B/s | 56.8 KiB | 00m00s [273/365] Installing libXcursor-0:1.2.3 100% | 0.0 B/s | 55.2 KiB | 00m00s [274/365] Installing libXdamage-0:1.1.6 100% | 0.0 B/s | 45.1 KiB | 00m00s [275/365] Installing libXinerama-0:1.1. 100% | 0.0 B/s | 19.9 KiB | 00m00s [276/365] Installing libXcomposite-0:0. 100% | 0.0 B/s | 45.9 KiB | 00m00s [277/365] Installing libxkbfile-0:1.1.3 100% | 217.8 MiB/s | 223.0 KiB | 00m00s [278/365] Installing libxkbfile-devel-0 100% | 0.0 B/s | 38.1 KiB | 00m00s [279/365] Installing libxklavier-0:5.4- 100% | 156.0 MiB/s | 159.7 KiB | 00m00s [280/365] Installing libXcomposite-deve 100% | 0.0 B/s | 10.5 KiB | 00m00s [281/365] Installing libXinerama-devel- 100% | 0.0 B/s | 8.5 KiB | 00m00s [282/365] Installing libXcursor-devel-0 100% | 32.0 MiB/s | 32.8 KiB | 00m00s [283/365] Installing libXrandr-devel-0: 100% | 0.0 B/s | 24.7 KiB | 00m00s [284/365] Installing libXtst-0:1.2.5-1. 100% | 0.0 B/s | 42.4 KiB | 00m00s [285/365] Installing libXft-0:2.3.8-7.f 100% | 169.7 MiB/s | 173.8 KiB | 00m00s [286/365] Installing pango-0:1.54.0-2.f 100% | 207.1 MiB/s | 1.0 MiB | 00m00s [287/365] Installing libXtst-devel-0:1. 100% | 0.0 B/s | 14.0 KiB | 00m00s [288/365] Installing setxkbmap-0:1.3.4- 100% | 0.0 B/s | 36.2 KiB | 00m00s [289/365] Installing libXdamage-devel-0 100% | 0.0 B/s | 3.1 KiB | 00m00s [290/365] Installing harfbuzz-cairo-0:1 100% | 0.0 B/s | 46.9 KiB | 00m00s [291/365] Installing libXxf86vm-0:1.1.6 100% | 0.0 B/s | 25.2 KiB | 00m00s [292/365] Installing mesa-libGL-0:24.3. 100% | 265.5 MiB/s | 543.8 KiB | 00m00s [293/365] Installing libglvnd-glx-1:1.7 100% | 388.1 MiB/s | 794.8 KiB | 00m00s [294/365] Installing xprop-0:1.2.7-2.fc 100% | 62.5 MiB/s | 64.0 KiB | 00m00s [295/365] Installing at-spi2-core-0:2.5 100% | 173.0 MiB/s | 1.6 MiB | 00m00s [296/365] Installing atk-0:2.54.0-1.fc4 100% | 267.6 MiB/s | 274.0 KiB | 00m00s [297/365] Installing at-spi2-atk-0:2.54 100% | 148.9 MiB/s | 305.0 KiB | 00m00s [298/365] Installing gtk3-0:3.24.43-2.f 100% | 304.0 MiB/s | 23.1 MiB | 00m00s [299/365] Installing libgnomekbd-0:3.28 100% | 56.8 MiB/s | 640.3 KiB | 00m00s [300/365] Installing gtk2-0:2.24.33-19. 100% | 301.1 MiB/s | 13.2 MiB | 00m00s [301/365] Installing libdbusmenu-gtk3-0 100% | 91.3 MiB/s | 93.5 KiB | 00m00s [302/365] Installing cinnamon-desktop-0 100% | 129.5 MiB/s | 1.0 MiB | 00m00s [303/365] Installing xmodmap-0:1.0.11-7 100% | 0.0 B/s | 56.2 KiB | 00m00s [304/365] Installing libXt-0:1.3.1-1.fc 100% | 231.2 MiB/s | 473.5 KiB | 00m00s [305/365] Installing libXmu-0:1.2.1-2.f 100% | 208.0 MiB/s | 213.0 KiB | 00m00s [306/365] Installing xhost-0:1.0.9-8.fc 100% | 0.0 B/s | 26.4 KiB | 00m00s [307/365] Installing xorg-x11-xauth-1:1 100% | 0.0 B/s | 65.1 KiB | 00m00s [308/365] Installing xrdb-0:1.2.2-4.fc4 100% | 0.0 B/s | 47.6 KiB | 00m00s [309/365] Installing xorg-x11-xinit-0:1 100% | 68.0 MiB/s | 139.2 KiB | 00m00s [310/365] Installing xapps-0:2.8.7-1.fc 100% | 321.6 MiB/s | 6.1 MiB | 00m00s [311/365] Installing python3-xapps-over 100% | 0.0 B/s | 2.7 KiB | 00m00s [312/365] Installing sound-theme-freede 100% | 57.0 MiB/s | 467.2 KiB | 00m00s [313/365] Installing alsa-lib-0:1.2.13- 100% | 188.6 MiB/s | 1.5 MiB | 00m00s [314/365] Installing libcanberra-0:0.30 100% | 46.6 MiB/s | 286.2 KiB | 00m00s [315/365] Installing libcanberra-gtk3-0 100% | 71.8 MiB/s | 73.6 KiB | 00m00s [316/365] Installing libcanberra-gtk2-0 100% | 49.9 MiB/s | 51.1 KiB | 00m00s [317/365] Installing pcre2-utf32-0:10.4 100% | 290.2 MiB/s | 594.4 KiB | 00m00s [318/365] Installing pcre2-utf16-0:10.4 100% | 203.9 MiB/s | 626.4 KiB | 00m00s [319/365] Installing pcre2-devel-0:10.4 100% | 249.4 MiB/s | 2.0 MiB | 00m00s [320/365] Installing libsepol-devel-0:3 100% | 62.6 MiB/s | 128.3 KiB | 00m00s [321/365] Installing libselinux-devel-0 100% | 39.5 MiB/s | 161.6 KiB | 00m00s [322/365] Installing libblkid-devel-0:2 100% | 0.0 B/s | 46.0 KiB | 00m00s [323/365] Installing libmount-devel-0:2 100% | 0.0 B/s | 64.5 KiB | 00m00s [324/365] Installing vim-filesystem-2:9 100% | 4.6 MiB/s | 4.7 KiB | 00m00s [325/365] Installing ninja-build-0:1.12 100% | 216.2 MiB/s | 442.7 KiB | 00m00s [326/365] Installing gettext-common-dev 100% | 575.4 MiB/s | 589.3 KiB | 00m00s [327/365] Installing gettext-devel-0:0. 100% | 242.5 MiB/s | 1.2 MiB | 00m00s [328/365] Installing make-1:4.4.1-9.fc4 100% | 266.1 MiB/s | 1.9 MiB | 00m00s [329/365] Installing gcc-0:15.0.0-0.2.f 100% | 313.2 MiB/s | 79.2 MiB | 00m00s [330/365] Installing libxslt-0:1.1.42-2 100% | 121.5 MiB/s | 497.6 KiB | 00m00s [331/365] Installing libuuid-devel-0:2. 100% | 42.8 MiB/s | 43.8 KiB | 00m00s [332/365] Installing libglvnd-core-deve 100% | 40.1 MiB/s | 41.1 KiB | 00m00s [333/365] Installing libglvnd-devel-1:1 100% | 353.4 MiB/s | 2.1 MiB | 00m00s [334/365] Installing libepoxy-devel-0:1 100% | 397.4 MiB/s | 1.6 MiB | 00m00s [335/365] Installing sysprof-capture-de 100% | 84.0 MiB/s | 258.2 KiB | 00m00s [336/365] Installing glib2-devel-0:2.83 100% | 330.5 MiB/s | 15.9 MiB | 00m00s [337/365] Installing atk-devel-0:2.54.0 100% | 223.5 MiB/s | 6.0 MiB | 00m00s [338/365] Installing gdk-pixbuf2-devel- 100% | 143.8 MiB/s | 2.3 MiB | 00m00s [339/365] Installing fontconfig-devel-0 100% | 21.2 MiB/s | 151.9 KiB | 00m00s [340/365] Installing cairo-devel-0:1.18 100% | 327.3 MiB/s | 2.3 MiB | 00m00s [341/365] Installing freetype-devel-0:2 100% | 341.7 MiB/s | 8.5 MiB | 00m00s [342/365] Installing harfbuzz-devel-0:1 100% | 342.0 MiB/s | 5.1 MiB | 00m00s [343/365] Installing libXft-devel-0:2.3 100% | 21.6 MiB/s | 44.3 KiB | 00m00s [344/365] Installing pango-devel-0:1.54 100% | 300.7 MiB/s | 1.5 MiB | 00m00s [345/365] Installing gtk2-devel-0:2.24. 100% | 361.6 MiB/s | 23.9 MiB | 00m00s [346/365] Installing cairo-gobject-deve 100% | 7.4 MiB/s | 7.6 KiB | 00m00s [347/365] Installing pulseaudio-libs-de 100% | 309.3 MiB/s | 4.9 MiB | 00m00s [348/365] Installing libxklavier-devel- 100% | 80.9 MiB/s | 248.4 KiB | 00m00s [349/365] Installing systemd-devel-0:25 100% | 42.6 MiB/s | 741.5 KiB | 00m00s [350/365] Installing dbus-devel-1:1.16. 100% | 66.6 MiB/s | 136.5 KiB | 00m00s [351/365] Installing at-spi2-core-devel 100% | 277.0 MiB/s | 4.2 MiB | 00m00s [352/365] Installing at-spi2-atk-devel- 100% | 1.1 MiB/s | 2.2 KiB | 00m00s [353/365] Installing gtk3-devel-0:3.24. 100% | 369.6 MiB/s | 34.0 MiB | 00m00s [354/365] Installing libgnomekbd-devel- 100% | 118.6 MiB/s | 121.4 KiB | 00m00s [355/365] Installing xapps-devel-0:2.8. 100% | 499.9 MiB/s | 511.9 KiB | 00m00s [356/365] Installing libcanberra-devel- 100% | 145.5 MiB/s | 149.0 KiB | 00m00s [357/365] Installing cinnamon-desktop-d 100% | 245.4 MiB/s | 502.6 KiB | 00m00s [358/365] Installing libSM-devel-0:1.2. 100% | 0.0 B/s | 19.7 KiB | 00m00s [359/365] Installing xmlto-0:0.0.29-1.f 100% | 61.5 MiB/s | 126.0 KiB | 00m00s [360/365] Installing gcc-plugin-annobin 100% | 4.7 MiB/s | 52.9 KiB | 00m00s [361/365] Installing annobin-plugin-gcc 100% | 74.1 MiB/s | 986.7 KiB | 00m00s [362/365] Installing intltool-0:0.51.0- 100% | 55.9 MiB/s | 171.8 KiB | 00m00s [363/365] Installing meson-0:1.6.1-1.fc 100% | 235.5 MiB/s | 11.5 MiB | 00m00s [364/365] Installing systemd-rpm-macros 100% | 0.0 B/s | 11.2 KiB | 00m00s [365/365] Installing xorg-x11-xtrans-de 100% | 444.6 KiB/s | 283.6 KiB | 00m01s Warning: skipped OpenPGP checks for 21 packages from repositories: copr_base, https_fedorapeople_org_dmalcolm_gcc_gcc_15_mass_prebuild_basearch Complete! Finish: build setup for cinnamon-session-6.4.0-1.fc42.src.rpm Start: rpmbuild cinnamon-session-6.4.0-1.fc42.src.rpm Building target platforms: s390x Building for target s390x setting SOURCE_DATE_EPOCH=1732665600 Executing(%mkbuilddir): /bin/sh -e /var/tmp/rpm-tmp.tS1Ka0 + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + test -d /builddir/build/BUILD/cinnamon-session-6.4.0-build + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w /builddir/build/BUILD/cinnamon-session-6.4.0-build + /usr/bin/rm -rf /builddir/build/BUILD/cinnamon-session-6.4.0-build + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.4.0-build + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.4.0-build/SPECPARTS + RPM_EC=0 ++ jobs -p + exit 0 Executing(%prep): /bin/sh -e /var/tmp/rpm-tmp.hMOaL8 + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + rm -rf cinnamon-session-6.4.0 + /usr/lib/rpm/rpmuncompress -x /builddir/build/SOURCES/cinnamon-session-6.4.0.tar.gz + STATUS=0 + '[' 0 -ne 0 ']' + cd cinnamon-session-6.4.0 + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w . + RPM_EC=0 ++ jobs -p + exit 0 Executing(%build): /bin/sh -e /var/tmp/rpm-tmp.kgTsjX + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + CFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none -Clink-arg=-specs=/usr/lib/rpm/redhat/redhat-package-notes --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=gcc + export CC + CXX=g++ + export CXX + cd cinnamon-session-6.4.0 + CFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none -Clink-arg=-specs=/usr/lib/rpm/redhat/redhat-package-notes --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=gcc + export CC + CXX=g++ + export CXX + /usr/bin/meson setup --buildtype=plain --prefix=/usr --libdir=/usr/lib64 --libexecdir=/usr/libexec --bindir=/usr/bin --sbindir=/usr/sbin --includedir=/usr/include --datadir=/usr/share --mandir=/usr/share/man --infodir=/usr/share/info --localedir=/usr/share/locale --sysconfdir=/etc --localstatedir=/var --sharedstatedir=/var/lib --wrap-mode=nodownload --auto-features=enabled . redhat-linux-build The Meson build system Version: 1.6.1 Source dir: /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0 Build dir: /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build Build type: native build Project name: cinnamon-session Project version: 6.4.0 C compiler for the host machine: gcc (gcc 15.0.0 "gcc (GCC) 15.0.0 20241203 (Red Hat 15.0.0-0)") C linker for the host machine: gcc ld.bfd 2.43.50.20241126 Host machine cpu family: s390x Host machine cpu: s390x Compiler for C supports arguments -Wno-deprecated-declarations: YES Compiler for C supports arguments -Wno-unused: YES Found pkg-config: YES (/usr/bin/pkg-config) 2.3.0 Run-time dependency gio-2.0 found: YES 2.83.0 Run-time dependency gtk+-3.0 found: YES 3.24.43 Run-time dependency glib-2.0 found: YES 2.83.0 Run-time dependency libcanberra found: YES 0.30 Run-time dependency pango found: YES 1.54.0 Run-time dependency pangoxft found: YES 1.54.0 Run-time dependency sm found: YES 1.2.5 Run-time dependency ice found: YES 1.1.2 Run-time dependency x11 found: YES 1.8.10 Run-time dependency xext found: YES 1.3.6 Run-time dependency xapp found: YES 2.8.7 Run-time dependency xau found: YES 1.0.12 Run-time dependency xcomposite found: YES 0.4.6 Run-time dependency gl found: YES 1.2 Run-time dependency cinnamon-desktop found: YES 6.4.1 Run-time dependency gio-unix-2.0 found: YES 2.83.0 Did not find CMake 'cmake' Found CMake: NO Run-time dependency libelogind found: NO (tried pkgconfig and cmake) Run-time dependency libsystemd-login found: NO (tried pkgconfig and cmake) Run-time dependency libsystemd found: YES 257 Run-time dependency xtst found: YES 1.2.5 Run-time dependency xrender found: YES 0.9.12 Has header "execinfo.h" : YES Library backtrace found: NO Library execinfo found: NO Run-time dependency xtrans found: YES 1.5.2 Checking for function "getaddrinfo" : YES Configuring config.h using configuration Dependency glib-2.0 found: YES 2.83.0 (cached) Program /usr/bin/glib-genmarshal found: YES (/usr/bin/glib-genmarshal) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Dependency gio-2.0 found: YES 2.83.0 (cached) Program /usr/bin/gdbus-codegen found: YES (/usr/bin/gdbus-codegen) Configuring cinnamon-session using configuration Configuring config.py using configuration Configuring cinnamon-session-quit using configuration Message: cinnamon-session 6.4.0 prefix: /usr exec_prefix: /usr libdir: lib64 libexecdir: libexec bindir: bin sbindir: sbin sysconfdir: /etc localstatedir: /var datadir: share source code location: /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0 compiler: gcc cflags: ['-Wno-deprecated-declarations', '-Wno-unused', '-DHAVE_CONFIG_H'] Logind support: true IPv6 support: true Backtrace support: false XRender support: true XTest support: true Build targets in project: 23 cinnamon-session 6.4.0 User defined options auto_features : enabled bindir : /usr/bin buildtype : plain datadir : /usr/share includedir : /usr/include infodir : /usr/share/info libdir : /usr/lib64 libexecdir : /usr/libexec localedir : /usr/share/locale localstatedir : /var mandir : /usr/share/man prefix : /usr sbindir : /usr/sbin sharedstatedir: /var/lib sysconfdir : /etc wrap_mode : nodownload Found ninja-1.12.1 at /usr/bin/ninja + /usr/bin/meson compile -C redhat-linux-build -j 2 --verbose ninja: Entering directory `/builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build' [1/60] /usr/bin/glib-genmarshal --quiet --prefix csm_marshal --output cinnamon-session/csm-marshal.h --header ../cinnamon-session/csm-marshal.list --pragma-once [2/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager. --c-namespace Csm --annotate org.gnome.SessionManager org.gtk.GDBus.C.Name ExportedManager --body --output cinnamon-session/csm-exported-manager.c ../cinnamon-session/org.gnome.SessionManager.xml [3/60] /usr/bin/glib-genmarshal --quiet --prefix csm_marshal --output cinnamon-session/csm-marshal.c --body ../cinnamon-session/csm-marshal.list --include-header csm-marshal.h [4/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager. --c-namespace Csm --annotate org.gnome.SessionManager org.gtk.GDBus.C.Name ExportedManager --header --output cinnamon-session/csm-exported-manager.h ../cinnamon-session/org.gnome.SessionManager.xml [5/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Client. --c-namespace Csm --annotate org.gnome.SessionManager.Client org.gtk.GDBus.C.Name ExportedClient --body --output cinnamon-session/csm-exported-client.c ../cinnamon-session/org.gnome.SessionManager.Client.xml [6/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Client. --c-namespace Csm --annotate org.gnome.SessionManager.Client org.gtk.GDBus.C.Name ExportedClient --header --output cinnamon-session/csm-exported-client.h ../cinnamon-session/org.gnome.SessionManager.Client.xml [7/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.ClientPrivate. --c-namespace Csm --annotate org.gnome.SessionManager.ClientPrivate org.gtk.GDBus.C.Name ExportedClientPrivate --body --output cinnamon-session/csm-exported-client-private.c ../cinnamon-session/org.gnome.SessionManager.ClientPrivate.xml [8/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.ClientPrivate. --c-namespace Csm --annotate org.gnome.SessionManager.ClientPrivate org.gtk.GDBus.C.Name ExportedClientPrivate --header --output cinnamon-session/csm-exported-client-private.h ../cinnamon-session/org.gnome.SessionManager.ClientPrivate.xml [9/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.App. --c-namespace Csm --annotate org.gnome.SessionManager.App org.gtk.GDBus.C.Name ExportedApp --body --output cinnamon-session/csm-exported-app.c ../cinnamon-session/org.gnome.SessionManager.App.xml [10/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.App. --c-namespace Csm --annotate org.gnome.SessionManager.App org.gtk.GDBus.C.Name ExportedApp --header --output cinnamon-session/csm-exported-app.h ../cinnamon-session/org.gnome.SessionManager.App.xml [11/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Inhibitor. --c-namespace Csm --annotate org.gnome.SessionManager.Inhibitor org.gtk.GDBus.C.Name ExportedInhibitor --body --output cinnamon-session/csm-exported-inhibitor.c ../cinnamon-session/org.gnome.SessionManager.Inhibitor.xml [12/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Inhibitor. --c-namespace Csm --annotate org.gnome.SessionManager.Inhibitor org.gtk.GDBus.C.Name ExportedInhibitor --header --output cinnamon-session/csm-exported-inhibitor.h ../cinnamon-session/org.gnome.SessionManager.Inhibitor.xml [13/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Presence. --c-namespace Csm --annotate org.gnome.SessionManager.Presence org.gtk.GDBus.C.Name ExportedPresence --body --output cinnamon-session/csm-exported-presence.c ../cinnamon-session/org.gnome.SessionManager.Presence.xml [14/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.gnome.SessionManager.Presence. --c-namespace Csm --annotate org.gnome.SessionManager.Presence org.gtk.GDBus.C.Name ExportedPresence --header --output cinnamon-session/csm-exported-presence.h ../cinnamon-session/org.gnome.SessionManager.Presence.xml [15/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.cinnamon.SessionManager.EndSessionDialog. --c-namespace Csm --annotate org.cinnamon.SessionManager.EndSessionDialog org.gtk.GDBus.C.Name ExportedDialog --body --output cinnamon-session/csm-exported-dialog.c ../cinnamon-session/org.cinnamon.SessionManager.EndSessionDialog.xml [16/60] /usr/bin/gdbus-codegen --c-generate-autocleanup all --interface-prefix org.cinnamon.SessionManager.EndSessionDialog. --c-namespace Csm --annotate org.cinnamon.SessionManager.EndSessionDialog org.gtk.GDBus.C.Name ExportedDialog --header --output cinnamon-session/csm-exported-dialog.h ../cinnamon-session/org.cinnamon.SessionManager.EndSessionDialog.xml [17/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o -c cinnamon-session/csm-marshal.c [18/60] gcc -Icinnamon-session/test-inhibit.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -DWITH_GZFILEOP -MD -MQ cinnamon-session/test-inhibit.p/test-inhibit.c.o -MF cinnamon-session/test-inhibit.p/test-inhibit.c.o.d -o cinnamon-session/test-inhibit.p/test-inhibit.c.o -c ../cinnamon-session/test-inhibit.c [19/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o -c cinnamon-session/csm-exported-client.c [20/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o -c cinnamon-session/csm-exported-manager.c [21/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o -c cinnamon-session/csm-exported-client-private.c [22/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o -c cinnamon-session/csm-exported-app.c [23/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o -c cinnamon-session/csm-exported-inhibitor.c [24/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o -c cinnamon-session/csm-exported-presence.c [25/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-dialog.c.o -MF cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-dialog.c.o.d -o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-dialog.c.o -c cinnamon-session/csm-exported-dialog.c [26/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-app.c.o -c ../cinnamon-session/csm-app.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-app.c:26: ../cinnamon-session/csm-app.c: In function ‘csm_app_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-app.c:32:33: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 32 | #define CSM_APP_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_APP, CsmAppPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-app.c:208:21: note: in expansion of macro ‘CSM_APP_GET_PRIVATE’ 208 | app->priv = CSM_APP_GET_PRIVATE (app); | ^~~~~~~~~~~~~~~~~~~ [27/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o -c ../cinnamon-session/csm-autostart-app.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-autostart-app.c:29: ../cinnamon-session/csm-autostart-app.c: In function ‘csm_autostart_app_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-autostart-app.c:90:48: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 90 | #define CSM_AUTOSTART_APP_GET_PRIVATE(object) (G_TYPE_INSTANCE_GET_PRIVATE ((object), CSM_TYPE_AUTOSTART_APP, CsmAutostartAppPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-autostart-app.c:100:21: note: in expansion of macro ‘CSM_AUTOSTART_APP_GET_PRIVATE’ 100 | app->priv = CSM_AUTOSTART_APP_GET_PRIVATE (app); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~ [28/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-client.c.o -c ../cinnamon-session/csm-client.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from /usr/include/glib-2.0/gobject/gbinding.h:30, from /usr/include/glib-2.0/glib-object.h:24, from cinnamon-session/csm-marshal.h:4, from ../cinnamon-session/csm-client.c:24: ../cinnamon-session/csm-client.c: In function ‘csm_client_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-client.c:30:36: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 30 | #define CSM_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_CLIENT, CsmClientPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-client.c:244:24: note: in expansion of macro ‘CSM_CLIENT_GET_PRIVATE’ 244 | client->priv = CSM_CLIENT_GET_PRIVATE (client); | ^~~~~~~~~~~~~~~~~~~~~~ [29/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o -c ../cinnamon-session/csm-dbus-client.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from /usr/include/glib-2.0/gobject/gbinding.h:30, from /usr/include/glib-2.0/glib-object.h:24, from /usr/include/glib-2.0/gio/gioenums.h:30, from /usr/include/glib-2.0/gio/giotypes.h:30, from /usr/include/glib-2.0/gio/gio.h:28, from ../cinnamon-session/csm-dbus-client.c:28: ../cinnamon-session/csm-dbus-client.c: In function ‘csm_dbus_client_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-dbus-client.c:36:41: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 36 | #define CSM_DBUS_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_DBUS_CLIENT, CsmDBusClientPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-dbus-client.c:135:24: note: in expansion of macro ‘CSM_DBUS_CLIENT_GET_PRIVATE’ 135 | client->priv = CSM_DBUS_CLIENT_GET_PRIVATE (client); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ In file included from /usr/include/glib-2.0/glib/glist.h:34, from /usr/include/glib-2.0/glib/ghash.h:36, from /usr/include/glib-2.0/glib.h:52: ../cinnamon-session/csm-dbus-client.c: In function ‘get_caller_info’: ../cinnamon-session/csm-dbus-client.c:217:40: warning: function called through a non-compatible type 217 | g_clear_pointer (&uid_variant, (GDestroyNotify) g_variant_unref); /usr/include/glib-2.0/glib/gmem.h:143:8: note: in definition of macro ‘g_clear_pointer’ 143 | (destroy) (_ptr); \ | ^~~~~~~ ../cinnamon-session/csm-dbus-client.c:218:40: warning: function called through a non-compatible type 218 | g_clear_pointer (&pid_variant, (GDestroyNotify) g_variant_unref); /usr/include/glib-2.0/glib/gmem.h:143:8: note: in definition of macro ‘g_clear_pointer’ 143 | (destroy) (_ptr); \ | ^~~~~~~ [30/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o -c ../cinnamon-session/csm-consolekit.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-consolekit.c:28: ../cinnamon-session/csm-consolekit.c: In function ‘csm_consolekit_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-consolekit.c:225:25: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 225 | manager->priv = G_TYPE_INSTANCE_GET_PRIVATE (manager, | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ [31/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o -c ../cinnamon-session/csm-inhibitor.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from /usr/include/glib-2.0/gobject/gbinding.h:30, from /usr/include/glib-2.0/glib-object.h:24, from ../cinnamon-session/csm-inhibitor.h:24, from ../cinnamon-session/csm-inhibitor.c:29: ../cinnamon-session/csm-inhibitor.c: In function ‘csm_inhibitor_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-inhibitor.c:36:39: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 36 | #define CSM_INHIBITOR_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_INHIBITOR, CsmInhibitorPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-inhibitor.c:244:27: note: in expansion of macro ‘CSM_INHIBITOR_GET_PRIVATE’ 244 | inhibitor->priv = CSM_INHIBITOR_GET_PRIVATE (inhibitor); | ^~~~~~~~~~~~~~~~~~~~~~~~~ [32/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o -c ../cinnamon-session/csm-presence.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from /usr/include/glib-2.0/gobject/gbinding.h:30, from /usr/include/glib-2.0/glib-object.h:24, from /usr/include/cinnamon-desktop/libcinnamon-desktop/gnome-idle-monitor.h:30, from ../cinnamon-session/csm-presence.c:30: ../cinnamon-session/csm-presence.c: In function ‘csm_presence_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-presence.c:48:38: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 48 | #define CSM_PRESENCE_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_PRESENCE, CsmPresencePrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-presence.c:426:26: note: in expansion of macro ‘CSM_PRESENCE_GET_PRIVATE’ 426 | presence->priv = CSM_PRESENCE_GET_PRIVATE (presence); | ^~~~~~~~~~~~~~~~~~~~~~~~ [33/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o -c ../cinnamon-session/csm-process-helper.c [34/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o -c ../cinnamon-session/csm-session-fill.c [35/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o -c ../cinnamon-session/csm-manager.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-manager.c:34: ../cinnamon-session/csm-manager.c: In function ‘csm_manager_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-manager.c:61:37: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 61 | #define CSM_MANAGER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_MANAGER, CsmManagerPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-manager.c:3637:25: note: in expansion of macro ‘CSM_MANAGER_GET_PRIVATE’ 3637 | manager->priv = CSM_MANAGER_GET_PRIVATE (manager); | ^~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-manager.c: In function ‘process_is_running’: ../cinnamon-session/csm-manager.c:1105:9: warning: ignoring return value of ‘fscanf’ declared with attribute ‘warn_unused_result’ [-Wunused-result] 1105 | fscanf(fp, "%d", &num_processes); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ [36/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o -c ../cinnamon-session/csm-session-save.c [37/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-store.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-store.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-store.c.o -c ../cinnamon-session/csm-store.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-store.c:29: ../cinnamon-session/csm-store.c: In function ‘csm_store_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-store.c:35:35: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 35 | #define CSM_STORE_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_STORE, CsmStorePrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-store.c:379:23: note: in expansion of macro ‘CSM_STORE_GET_PRIVATE’ 379 | store->priv = CSM_STORE_GET_PRIVATE (store); | ^~~~~~~~~~~~~~~~~~~~~ [38/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-system.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-system.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-system.c.o -c ../cinnamon-session/csm-system.c [39/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o -c ../cinnamon-session/csm-systemd.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-systemd.h:27, from ../cinnamon-session/csm-systemd.c:24: ../cinnamon-session/csm-systemd.c: In function ‘csm_systemd_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-systemd.c:118:25: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 118 | manager->priv = G_TYPE_INSTANCE_GET_PRIVATE (manager, | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ [40/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-util.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-util.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-util.c.o -c ../cinnamon-session/csm-util.c [41/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o -c ../cinnamon-session/csm-xsmp-server.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/csm-xsmp-server.c:34: ../cinnamon-session/csm-xsmp-server.c: In function ‘csm_xsmp_server_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-xsmp-server.c:65:41: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 65 | #define CSM_XSMP_SERVER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_XSMP_SERVER, CsmXsmpServerPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-xsmp-server.c:713:29: note: in expansion of macro ‘CSM_XSMP_SERVER_GET_PRIVATE’ 713 | xsmp_server->priv = CSM_XSMP_SERVER_GET_PRIVATE (xsmp_server); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ [42/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o -MF cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o.d -o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o -c ../cinnamon-session/csm-xsmp-client.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from /usr/include/glib-2.0/gobject/gbinding.h:30, from /usr/include/glib-2.0/glib-object.h:24, from /usr/include/glib-2.0/gio/gioenums.h:30, from /usr/include/glib-2.0/gio/giotypes.h:30, from /usr/include/glib-2.0/gio/gio.h:28, from ../cinnamon-session/csm-xsmp-client.c:31: ../cinnamon-session/csm-xsmp-client.c: In function ‘csm_xsmp_client_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-xsmp-client.c:43:41: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 43 | #define CSM_XSMP_CLIENT_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), CSM_TYPE_XSMP_CLIENT, CsmXSMPClientPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/csm-xsmp-client.c:200:24: note: in expansion of macro ‘CSM_XSMP_CLIENT_GET_PRIVATE’ 200 | client->priv = CSM_XSMP_CLIENT_GET_PRIVATE (client); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ [43/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o -MF cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o.d -o cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o -c ../cinnamon-session/inhibit-dialog-info.c [44/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/main.c.o -MF cinnamon-session/cinnamon-session-binary.p/main.c.o.d -o cinnamon-session/cinnamon-session-binary.p/main.c.o -c ../cinnamon-session/main.c [45/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o -c ../cinnamon-session/mdm-log.c [46/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o -c ../cinnamon-session/mdm-signal-handler.c In file included from /usr/lib64/glib-2.0/include/glibconfig.h:9, from /usr/include/glib-2.0/glib/gtypes.h:34, from /usr/include/glib-2.0/glib/galloca.h:34, from /usr/include/glib-2.0/glib.h:32, from ../cinnamon-session/mdm-signal-handler.c:37: ../cinnamon-session/mdm-signal-handler.c: In function ‘mdm_signal_handler_init’: /usr/include/glib-2.0/glib/gmacros.h:1303:33: warning: Deprecated pre-processor symbol: replace with "G_ADD_PRIVATE" 1303 | #define _GLIB_GNUC_DO_PRAGMA(x) _Pragma(G_STRINGIFY (x)) | ^~~~~~~ /usr/include/glib-2.0/glib/gmacros.h:1306:3: note: in expansion of macro ‘_GLIB_GNUC_DO_PRAGMA’ 1306 | _GLIB_GNUC_DO_PRAGMA(GCC warning G_STRINGIFY (Deprecated pre-processor symbol: replace with #f)) | ^~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gobject-visibility.h:584:49: note: in expansion of macro ‘GLIB_DEPRECATED_MACRO_FOR’ 584 | #define GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(f) GLIB_DEPRECATED_MACRO_FOR (f) | ^~~~~~~~~~~~~~~~~~~~~~~~~ /usr/include/glib-2.0/gobject/gtype.h:688:145: note: in expansion of macro ‘GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR’ 688 | #define G_TYPE_INSTANCE_GET_PRIVATE(instance, g_type, c_type) ((c_type*) g_type_instance_get_private ((GTypeInstance*) (instance), (g_type))) GOBJECT_DEPRECATED_MACRO_IN_2_58_FOR(G_ADD_PRIVATE) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/mdm-signal-handler.c:44:44: note: in expansion of macro ‘G_TYPE_INSTANCE_GET_PRIVATE’ 44 | #define MDM_SIGNAL_HANDLER_GET_PRIVATE(o) (G_TYPE_INSTANCE_GET_PRIVATE ((o), MDM_TYPE_SIGNAL_HANDLER, MdmSignalHandlerPrivate)) | ^~~~~~~~~~~~~~~~~~~~~~~~~~~ ../cinnamon-session/mdm-signal-handler.c:480:25: note: in expansion of macro ‘MDM_SIGNAL_HANDLER_GET_PRIVATE’ 480 | handler->priv = MDM_SIGNAL_HANDLER_GET_PRIVATE (handler); | ^~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ [47/60] gcc -Icinnamon-session/test-client-dbus.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -MF cinnamon-session/test-client-dbus.p/test-client-dbus.c.o.d -o cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -c ../cinnamon-session/test-client-dbus.c [48/60] gcc -Icinnamon-session/cinnamon-session-binary.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/cinnamon-desktop -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -I/usr/include/uuid -I/usr/include/xapp -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -pthread -D_REENTRANT -DWITH_GZFILEOP -MD -MQ cinnamon-session/cinnamon-session-binary.p/mdm.c.o -MF cinnamon-session/cinnamon-session-binary.p/mdm.c.o.d -o cinnamon-session/cinnamon-session-binary.p/mdm.c.o -c ../cinnamon-session/mdm.c [49/60] gcc -Icinnamon-session/test-process-helper.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-process-helper.p/test-process-helper.c.o -MF cinnamon-session/test-process-helper.p/test-process-helper.c.o.d -o cinnamon-session/test-process-helper.p/test-process-helper.c.o -c ../cinnamon-session/test-process-helper.c [50/60] gcc -Icinnamon-session/test-process-helper.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-process-helper.p/csm-process-helper.c.o -MF cinnamon-session/test-process-helper.p/csm-process-helper.c.o.d -o cinnamon-session/test-process-helper.p/csm-process-helper.c.o -c ../cinnamon-session/csm-process-helper.c [51/60] gcc -Icinnamon-session/test-session-proxy-monitor.p -Icinnamon-session -I../cinnamon-session -I. -I.. -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -MF cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o.d -o cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -c ../cinnamon-session/test-session-proxy-monitor.c [52/60] gcc -Itools/cinnamon-session-check-accelerated-helper.p -Itools -I../tools -I. -I.. -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -MD -MQ tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -MF tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o.d -o tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -c ../tools/cinnamon-session-check-accelerated-helper.c [53/60] gcc -Itools/cinnamon-session-check-accelerated.p -Itools -I../tools -I. -I.. -I/usr/include/gtk-3.0 -I/usr/include/pango-1.0 -I/usr/include/cloudproviders -I/usr/include/cairo -I/usr/include/gdk-pixbuf-2.0 -I/usr/include/webp -I/usr/include/at-spi2-atk/2.0 -I/usr/include/at-spi-2.0 -I/usr/include/atk-1.0 -I/usr/lib64/pkgconfig/../../include/dbus-1.0 -I/usr/lib64/pkgconfig/../../lib64/dbus-1.0/include -I/usr/include/fribidi -I/usr/include/libxml2 -I/usr/include/pixman-1 -I/usr/include/harfbuzz -I/usr/include/freetype2 -I/usr/include/libpng16 -I/usr/include/gio-unix-2.0 -I/usr/include/glib-2.0 -I/usr/lib64/glib-2.0/include -I/usr/include/libmount -I/usr/include/blkid -I/usr/include/sysprof-6 -fdiagnostics-color=always -D_FILE_OFFSET_BITS=64 -Wall -Winvalid-pch -Wno-deprecated-declarations -Wno-unused -DHAVE_CONFIG_H -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -DWITH_GZFILEOP -pthread -MD -MQ tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -MF tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o.d -o tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -c ../tools/cinnamon-session-check-accelerated.c [54/60] gcc -o cinnamon-session/test-inhibit cinnamon-session/test-inhibit.p/test-inhibit.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so -Wl,--end-group [55/60] gcc -o cinnamon-session/test-client-dbus cinnamon-session/test-client-dbus.p/test-client-dbus.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [56/60] gcc -o cinnamon-session/test-process-helper cinnamon-session/test-process-helper.p/test-process-helper.c.o cinnamon-session/test-process-helper.p/csm-process-helper.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [57/60] gcc -o cinnamon-session/test-session-proxy-monitor cinnamon-session/test-session-proxy-monitor.p/test-session-proxy-monitor.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so -Wl,--end-group [58/60] gcc -o tools/cinnamon-session-check-accelerated tools/cinnamon-session-check-accelerated.p/cinnamon-session-check-accelerated.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libX11.so -Wl,--end-group [59/60] gcc -o tools/cinnamon-session-check-accelerated-helper tools/cinnamon-session-check-accelerated-helper.p/cinnamon-session-check-accelerated-helper.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libGL.so /usr/lib64/libX11.so /usr/lib64/libXcomposite.so -Wl,--end-group [60/60] gcc -o cinnamon-session/cinnamon-session-binary cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-marshal.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-manager.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-client-private.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-app.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-inhibitor.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-presence.c.o cinnamon-session/cinnamon-session-binary.p/meson-generated_.._csm-exported-dialog.c.o cinnamon-session/cinnamon-session-binary.p/csm-app.c.o cinnamon-session/cinnamon-session-binary.p/csm-autostart-app.c.o cinnamon-session/cinnamon-session-binary.p/csm-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-consolekit.c.o cinnamon-session/cinnamon-session-binary.p/csm-dbus-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-inhibitor.c.o cinnamon-session/cinnamon-session-binary.p/csm-manager.c.o cinnamon-session/cinnamon-session-binary.p/csm-presence.c.o cinnamon-session/cinnamon-session-binary.p/csm-process-helper.c.o cinnamon-session/cinnamon-session-binary.p/csm-session-fill.c.o cinnamon-session/cinnamon-session-binary.p/csm-session-save.c.o cinnamon-session/cinnamon-session-binary.p/csm-store.c.o cinnamon-session/cinnamon-session-binary.p/csm-system.c.o cinnamon-session/cinnamon-session-binary.p/csm-systemd.c.o cinnamon-session/cinnamon-session-binary.p/csm-util.c.o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-client.c.o cinnamon-session/cinnamon-session-binary.p/csm-xsmp-server.c.o cinnamon-session/cinnamon-session-binary.p/inhibit-dialog-info.c.o cinnamon-session/cinnamon-session-binary.p/main.c.o cinnamon-session/cinnamon-session-binary.p/mdm-log.c.o cinnamon-session/cinnamon-session-binary.p/mdm-signal-handler.c.o cinnamon-session/cinnamon-session-binary.p/mdm.c.o -Wl,--as-needed -Wl,--no-undefined -Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes -O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -Wl,--start-group /usr/lib64/libcinnamon-desktop.so /usr/lib64/libgtk-3.so /usr/lib64/libgdk-3.so /usr/lib64/libz.so /usr/lib64/libpangocairo-1.0.so /usr/lib64/libpango-1.0.so /usr/lib64/libharfbuzz.so /usr/lib64/libatk-1.0.so /usr/lib64/libcairo-gobject.so /usr/lib64/libcairo.so /usr/lib64/libgdk_pixbuf-2.0.so /usr/lib64/libgio-2.0.so /usr/lib64/libgobject-2.0.so /usr/lib64/libglib-2.0.so /usr/lib64/libICE.so /usr/lib64/libcanberra.so /usr/lib64/libsystemd.so /usr/lib64/libSM.so /usr/lib64/libX11.so /usr/lib64/libxapp.so /usr/lib64/libXau.so /usr/lib64/libXext.so /usr/lib64/libXrender.so /usr/lib64/libXtst.so -Wl,--end-group INFO: autodetecting backend as ninja INFO: calculating backend command to run: /usr/bin/ninja -C /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build -j 2 -v + RPM_EC=0 ++ jobs -p + exit 0 Executing(%install): /bin/sh -e /var/tmp/rpm-tmp.vLS64q + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + '[' /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT '!=' / ']' + rm -rf /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT ++ dirname /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT + mkdir -p /builddir/build/BUILD/cinnamon-session-6.4.0-build + mkdir /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT + CFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CFLAGS + CXXFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Werror=format-security -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection ' + export CXXFLAGS + FFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FFLAGS + FCFLAGS='-O2 -flto=auto -ffat-lto-objects -fexceptions -g -grecord-gcc-switches -pipe -Wall -Wp,-U_FORTIFY_SOURCE,-D_FORTIFY_SOURCE=3 -Wp,-D_GLIBCXX_ASSERTIONS -specs=/usr/lib/rpm/redhat/redhat-hardened-cc1 -fstack-protector-strong -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -m64 -march=z13 -mtune=z14 -fasynchronous-unwind-tables -fstack-clash-protection -I/usr/lib64/gfortran/modules ' + export FCFLAGS + VALAFLAGS=-g + export VALAFLAGS + RUSTFLAGS='-Copt-level=3 -Cdebuginfo=2 -Ccodegen-units=1 -Cstrip=none -Clink-arg=-specs=/usr/lib/rpm/redhat/redhat-package-notes --cap-lints=warn' + export RUSTFLAGS + LDFLAGS='-Wl,-z,relro -Wl,--as-needed -Wl,-z,now -specs=/usr/lib/rpm/redhat/redhat-hardened-ld -specs=/usr/lib/rpm/redhat/redhat-annobin-cc1 -Wl,--build-id=sha1 -specs=/usr/lib/rpm/redhat/redhat-package-notes ' + export LDFLAGS + LT_SYS_LIBRARY_PATH=/usr/lib64: + export LT_SYS_LIBRARY_PATH + CC=gcc + export CC + CXX=g++ + export CXX + cd cinnamon-session-6.4.0 + DESTDIR=/builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT + /usr/bin/meson install -C redhat-linux-build --no-rebuild Installing cinnamon-session/cinnamon-session-binary to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/libexec Installing tools/cinnamon-session-check-accelerated to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/libexec Installing tools/cinnamon-session-check-accelerated-helper to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/libexec Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/doc/man/cinnamon-session.1 to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/man/man1 Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/doc/man/cinnamon-session-quit.1 to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/man/man1 Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build/cinnamon-session/cinnamon-session to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/bin Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/16x16/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/16x16/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/22x22/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/22x22/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/24x24/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/24x24/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/32x32/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/32x32/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/48x48/cinnamon-session-properties.png to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/48x48/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/icons/scalable/cinnamon-session-properties.svg to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/icons/hicolor/scalable/apps Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/hardware-compatibility to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/org.cinnamon.SessionManager.gschema.xml to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/glib-2.0/schemas Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build/cinnamon-session-quit/config.py to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/cinnamon-session-quit/cinnamon-session-quit.py to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/cinnamon-session-quit/cinnamon-session-quit.glade to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/cinnamon-session Installing /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/redhat-linux-build/cinnamon-session-quit/cinnamon-session-quit to /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/bin Running custom install script '/usr/bin/python3 /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/data/meson_install_schemas.py' + /usr/bin/find-debuginfo -j2 --strict-build-id -m -i --build-id-seed 6.4.0-1.fc42 --unique-debug-suffix -6.4.0-1.fc42.s390x --unique-debug-src-base cinnamon-session-6.4.0-1.fc42.s390x --run-dwz --dwz-low-mem-die-limit 10000000 --dwz-max-die-limit 50000000 -S debugsourcefiles.list /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0 find-debuginfo: starting Extracting debug info from 3 files DWARF-compressing 3 files sepdebugcrcfix: Updated 3 CRC32s, 0 CRC32s did match. Creating .debug symlinks for symlinks to ELF files Copying sources found by 'debugedit -l' to /usr/src/debug/cinnamon-session-6.4.0-1.fc42.s390x find-debuginfo: done + /usr/lib/rpm/check-buildroot + /usr/lib/rpm/redhat/brp-ldconfig + /usr/lib/rpm/brp-compress + /usr/lib/rpm/redhat/brp-strip-lto /usr/bin/strip + /usr/lib/rpm/brp-strip-static-archive /usr/bin/strip + /usr/lib/rpm/check-rpaths + /usr/lib/rpm/redhat/brp-mangle-shebangs mangling shebang in /usr/bin/cinnamon-session from /bin/sh to #!/usr/bin/sh mangling shebang in /usr/bin/cinnamon-session-quit from /bin/sh to #!/usr/bin/sh + /usr/lib/rpm/brp-remove-la-files + env /usr/lib/rpm/redhat/brp-python-bytecompile '' 1 0 -j2 + /usr/lib/rpm/redhat/brp-python-hardlink + /usr/bin/add-determinism --brp -j2 /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT Scanned 36 directories and 83 files, processed 0 inodes, 0 modified (0 replaced + 0 rewritten), 0 unsupported format, 0 errors Reading /builddir/build/BUILD/cinnamon-session-6.4.0-build/SPECPARTS/rpm-debuginfo.specpart Processing files: cinnamon-session-6.4.0-1.fc42.s390x Executing(%doc): /bin/sh -e /var/tmp/rpm-tmp.lDIqSK + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + cd cinnamon-session-6.4.0 + DOCDIR=/builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/doc/cinnamon-session + export LC_ALL=C.UTF-8 + LC_ALL=C.UTF-8 + export DOCDIR + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/doc/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/AUTHORS /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/doc/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/README /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/doc/cinnamon-session + RPM_EC=0 ++ jobs -p + exit 0 Executing(%license): /bin/sh -e /var/tmp/rpm-tmp.26v7YG + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + cd cinnamon-session-6.4.0 + LICENSEDIR=/builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/licenses/cinnamon-session + export LC_ALL=C.UTF-8 + LC_ALL=C.UTF-8 + export LICENSEDIR + /usr/bin/mkdir -p /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/licenses/cinnamon-session + cp -pr /builddir/build/BUILD/cinnamon-session-6.4.0-build/cinnamon-session-6.4.0/COPYING /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT/usr/share/licenses/cinnamon-session + RPM_EC=0 ++ jobs -p + exit 0 Provides: cinnamon-session = 6.4.0-1.fc42 cinnamon-session(s390-64) = 6.4.0-1.fc42 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Requires: /usr/bin/python3 /usr/bin/sh libGL.so.1()(64bit) libICE.so.6()(64bit) libSM.so.6()(64bit) libX11.so.6()(64bit) libXau.so.6()(64bit) libXcomposite.so.1()(64bit) libc.so.6()(64bit) libc.so.6(GLIBC_2.17)(64bit) libc.so.6(GLIBC_2.2)(64bit) libc.so.6(GLIBC_2.28)(64bit) libc.so.6(GLIBC_2.3)(64bit) libc.so.6(GLIBC_2.3.4)(64bit) libc.so.6(GLIBC_2.34)(64bit) libc.so.6(GLIBC_2.38)(64bit) libc.so.6(GLIBC_2.4)(64bit) libcanberra.so.0()(64bit) libcinnamon-desktop.so.4()(64bit) libgcc_s.so.1()(64bit) libgcc_s.so.1(GCC_3.0)(64bit) libgcc_s.so.1(GCC_3.3.1)(64bit) libgdk-3.so.0()(64bit) libgio-2.0.so.0()(64bit) libglib-2.0.so.0()(64bit) libgobject-2.0.so.0()(64bit) libgtk-3.so.0()(64bit) libsystemd.so.0()(64bit) libsystemd.so.0(LIBSYSTEMD_209)(64bit) rtld(GNU_HASH) Processing files: cinnamon-session-debugsource-6.4.0-1.fc42.s390x Provides: cinnamon-session-debugsource = 6.4.0-1.fc42 cinnamon-session-debugsource(s390-64) = 6.4.0-1.fc42 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Processing files: cinnamon-session-debuginfo-6.4.0-1.fc42.s390x Provides: cinnamon-session-debuginfo = 6.4.0-1.fc42 cinnamon-session-debuginfo(s390-64) = 6.4.0-1.fc42 debuginfo(build-id) = 0df370c9106a909a4006ecb82ff72d15453ab00e debuginfo(build-id) = 8a13c578aedd3943d50aa533cb9d5240451f0dac debuginfo(build-id) = bdf2720d2028c2c77e27007a47f3e603afe1f1b4 Requires(rpmlib): rpmlib(CompressedFileNames) <= 3.0.4-1 rpmlib(FileDigests) <= 4.6.0-1 rpmlib(PayloadFilesHavePrefix) <= 4.0-1 Recommends: cinnamon-session-debugsource(s390-64) = 6.4.0-1.fc42 Checking for unpackaged file(s): /usr/lib/rpm/check-files /builddir/build/BUILD/cinnamon-session-6.4.0-build/BUILDROOT Wrote: /builddir/build/RPMS/cinnamon-session-debuginfo-6.4.0-1.fc42.s390x.rpm Wrote: /builddir/build/RPMS/cinnamon-session-6.4.0-1.fc42.s390x.rpm Wrote: /builddir/build/RPMS/cinnamon-session-debugsource-6.4.0-1.fc42.s390x.rpm Executing(rmbuild): /bin/sh -e /var/tmp/rpm-tmp.vpVDe5 + umask 022 + cd /builddir/build/BUILD/cinnamon-session-6.4.0-build + test -d /builddir/build/BUILD/cinnamon-session-6.4.0-build + /usr/bin/chmod -Rf a+rX,u+w,g-w,o-w /builddir/build/BUILD/cinnamon-session-6.4.0-build + rm -rf /builddir/build/BUILD/cinnamon-session-6.4.0-build + RPM_EC=0 ++ jobs -p + exit 0 Finish: rpmbuild cinnamon-session-6.4.0-1.fc42.src.rpm Finish: build phase for cinnamon-session-6.4.0-1.fc42.src.rpm INFO: chroot_scan: 1 files copied to /var/lib/copr-rpmbuild/results/chroot_scan INFO: /var/lib/mock/fedora-rawhide-s390x-1734762221.542729/root/var/log/dnf5.log INFO: chroot_scan: creating tarball /var/lib/copr-rpmbuild/results/chroot_scan.tar.gz /bin/tar: Removing leading `/' from member names INFO: Done(/var/lib/copr-rpmbuild/results/cinnamon-session-6.4.0-1.fc42.src.rpm) Config(child) 0 minutes 29 seconds INFO: Results and/or logs in: /var/lib/copr-rpmbuild/results INFO: Cleaning up build root ('cleanup_on_success=True') Start: clean chroot INFO: unmounting tmpfs. Finish: clean chroot Finish: run Running RPMResults tool Package info: { "packages": [ { "name": "cinnamon-session", "epoch": null, "version": "6.4.0", "release": "1.fc42", "arch": "src" }, { "name": "cinnamon-session-debugsource", "epoch": null, "version": "6.4.0", "release": "1.fc42", "arch": "s390x" }, { "name": "cinnamon-session-debuginfo", "epoch": null, "version": "6.4.0", "release": "1.fc42", "arch": "s390x" }, { "name": "cinnamon-session", "epoch": null, "version": "6.4.0", "release": "1.fc42", "arch": "s390x" } ] } RPMResults finished